Basic Information
| Drug ID | DDPD06785 |
|
| Drug Name | Ganirelix | |
| Molecular Weight | 1570.35 | |
| Molecular Formula | C80H113ClN18O13 | |
| CAS Number | 124904-93-4 | |
| SMILES | CCNC(NCC)=NCCCC[C@@H](NC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](CO)NC(=O)[C@@H](CC1=CC=CN=C1)NC(=O)[C@@H](CC1=CC=C(Cl)C=C1)NC(=O)[C@@H](CC1=CC2=CC=CC=C2C=C1)NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN=C(NCC)NCC)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(N)=O | |
| External Links | ||
| DRUGBANK | DB06785 | |
| PubChem Compound | 16130957 | |
| PDR | 998 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 1.0 | h | 1 | h | subcutaneous injection, SC; | DRUGBANK |
| Metabolic | 17.8 | % | 17.1-18.4 | % | Urinary excretion; | DRUGBANK |
| Clearance | 2.4 | L/h | 2.4 | L/h | Single dose; | DRUGBANK | Clearance | 3.3 | L/h | 3.3 | L/h | Multiple dose; | DRUGBANK | Clearance | 0.0378 | L/h/kg | 0.63 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 43.7 | L | 43.7 | L | Average volume of distribution; intravenous injection, IV; normal,healthy; | DRUGBANK | Volume of Distribution | 0.21 | L/kg | 0.21 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 16.2 | h | 16.2 | h | DRUGBANK | Half-life | 9.1 | h | 9.09 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 75.1 | % | 75.1 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 22.1 | % | 22.1 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 81.9 | % | 81.9 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 0.25 | mg/day | 250 | mcg/day | subcutaneous injection, SC | Ganirelix Acetate | ganirelix acetate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1