Basic Information
| Drug ID | DDPD06775 |
|
| Drug Name | Carglumic acid | |
| Molecular Weight | 190.154 | |
| Molecular Formula | C6H10N2O5 | |
| CAS Number | 1188-38-1 | |
| SMILES | NC(=O)N[C@@H](CCC(O)=O)C(O)=O | |
| External Links | ||
| DRUGBANK | DB06775 | |
| PubChem Compound | 121396 | |
| PDR | 1243 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -1.097 | - | -1.097 | - | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 30.0 | % | 30 | % | DRUGBANK | |
| C Max | 2600.0 | ng/ml | 2.6(1.9-4.8) | ug/ml | DRUGBANK | |
| Clearance | 342.0 | L/h | 5.7(3.0-9.7) | L/min | apparent clearance; | DRUGBANK | Clearance | 17.4 | L/h | 290.0 | ml/min | Renal clearance; | DRUGBANK |
| Volume of Distribution | 2657.0 | L | 2657.0 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 5.6 | h | 5.6(4.3-9.5) | h | terminal half-life; intravenous infusion, IV in drop; | DRUGBANK |
| Toxicity LD50 | 1000.0 | mg/kg | >1000 | mg/kg | PO, oral; mouse; | DRUGBANK |
| Eliminate Route | 9.0 | % | 9 | % | Urinary excretion; Single dose; Unchanged drug; | DRUGBANK | Eliminate Route | 60.0 | % | 60 | % | Faeces excretion; Single dose; Unchanged drug; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1