Basic Information
| Drug ID | DDPD06716 |
|
| Drug Name | Fospropofol | |
| Molecular Weight | 288.2766 | |
| Molecular Formula | C13H21O5P | |
| CAS Number | 258516-89-1 | |
| SMILES | CC(C)C1=CC=CC(C(C)C)=C1OCOP(O)(O)=O | |
| External Links | ||
| DRUGBANK | DB06716 | |
| PubChem Compound | 3038498 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| pKa | 8.6 | - | 8.2-9.0 | - | FDA label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 19000.0 | ng.h/ml | 19.0 | ug.h/ml | intravenous injection, IV; normal,healthy; | DRUGBANK |
| C Max | 78700.0 | ng/ml | 78.7 | ug/ml | intravenous injection, IV; normal,healthy; | DRUGBANK |
| T Max | 0.0667 | h | 4 | min | intravenous injection, IV; normal,healthy; | DRUGBANK |
| Clearance | 0.28 | L/h/kg | 0.28 | L/h/kg | Total clearance; normal,healthy; | DRUGBANK | Clearance | 0.31 | L/h/kg | 0.31 | L/h/kg | Total clearance; patients; | DRUGBANK |
| Volume of Distribution | 0.33 | L/kg | 0.33±0.069 | L/kg | DRUGBANK | Volume of Distribution | 5.8 | L/kg | 5.8 | L/kg | DRUGBANK |
| Half-life | 0.81 | h | 0.81 | h | DRUGBANK | Half-life | 1.1 | h | 1.13 | h | Metabolite; | DRUGBANK |
| Protein Binding | 98.0 | % | ~98 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1