Basic Information
| Drug ID | DDPD06616 |
|
| Drug Name | Bosutinib | |
| Molecular Weight | 530.446 | |
| Molecular Formula | C26H29Cl2N5O3 | |
| CAS Number | 380843-75-4 | |
| SMILES | COC1=CC(NC2=C(C=NC3=CC(OCCCN4CCN(C)CC4)=C(OC)C=C23)C#N)=C(Cl)C=C1Cl | |
| External Links | ||
| DRUGBANK | DB06616 | |
| PubChem Compound | 5328940 | |
| PDR | 2592 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| AUC | 3650.0 | ng.h/ml | 3650.0 | ng.h/ml | PO, oral; Chronic myelogenous leukemia; food; | DRUGBANK | |
| C Max | 200.0 | ng/ml | 200 | ng/ml | PO, oral; Chronic myelogenous leukemia; food; | DRUGBANK | |
| T Max | 5.0 | h | 4-6 | h | Oral single dose; tumor; food; | DRUGBANK | |
| Clearance | 189.0 | L/h | 189.0 | L/h | Average clearance; Oral single dose; food; | DRUGBANK | |
| Volume of Distribution | 6080.0 | L | 6080 ± 1230 | L | Apparent volume of distribution; | DRUGBANK | |
| Half-life | 22.5 | h | 22.5 | h | elimination half-life; Oral single dose; | DRUGBANK | |
| Eliminate Route | 91.3 | % | 91.3 | % | Faeces excretion; Oral single dose; | DRUGBANK | |
| Eliminate Route | 3.0 | % | 3 | % | Urinary excretion; Oral single dose; | DRUGBANK | |
| Protein Binding | 94.0 | % | 94 | % | plasma proteins; high protein binding; | Plasma Concentration → ; | DRUGBANK |
| Protein Binding | 96.0 | % | 96 | % | plasma proteins; in vivo; normal,healthy; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 600.0 | mg/day | 600 | mg/day | PO, oral | Bosulif | bosutinib | PDR |
| Max dose for geriatric | 600.0 | mg/day | 600 | mg/day | PO, oral | Bosulif | bosutinib | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1