Basic Information
| Drug ID | DDPD06605 |
|
| Drug Name | Apixaban | |
| Molecular Weight | 459.4971 | |
| Molecular Formula | C25H25N5O4 | |
| CAS Number | 503612-47-3 | |
| SMILES | COC1=CC=C(C=C1)N1N=C(C(N)=O)C2=C1C(=O)N(CC2)C1=CC=C(C=C1)N1CCCCC1=O | |
| External Links | ||
| DRUGBANK | DB06605 | |
| PubChem Compound | 10182969 | |
| PDR | 3039 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.71 | - | 2.71 | - | [MSDS] |
| Boiling Point | 770.5 | ℃ | 770.5 | ℃ | [MSDS] |
| Melting Point | 326.53 | ℃ | 326.53 | ℃ | [MSDS] |
| Water Solubility | 110.0 | mg/L | 0.11 | mg/ml | http://www.chemspider.com/Chemical-Structure.8358471.html?rid=2f601343-f676-4fcd-ad7d-1151c737876f |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 50.0 | % | ~50 | % | DRUGBANK | Bioavailability | 44.5 | % | 43-46 | % | different study; | DRUGBANK |
| Metabolic | 50.0 | % | 50 | % | Urinary excretion; Faeces excretion; Unchanged drug; | DRUGBANK |
| Clearance | 3.3 | L/h | 3.3 | L/h | DRUGBANK | Clearance | 0.0480 | L/h/kg | 0.8 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 21.0 | L | ~21 | L | DRUGBANK | Volume of Distribution | 0.30 | L/kg | 0.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 12.7 | h | 12.7±8.55 | h | DRUGBANK | Half-life | 12.0 | h | 12 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 56.0 | % | 56 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 26.7 | % | 24.5-28.8 | % | Urinary excretion; PO, oral; | DRUGBANK |
| Protein Binding | 93.0 | % | 92-94 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 10.0 | mg/day | 10 | mg/day | PO, oral | Eliquis | apixaban | PDR |
| Max dose for adults | 20.0 | mg/day | 20 | mg/day | PO, oral | Eliquis | apixaban | PDR |
| Max dose for geriatric | 10.0 | mg/day | 10 | mg/day | PO, oral | Eliquis | apixaban | PDR |
| Max dose for geriatric | 20.0 | mg/day | 20 | mg/day | PO, oral | Eliquis | apixaban | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1