Basic Information
| Drug ID | DDPD06402 |
|
| Drug Name | Telavancin | |
| Molecular Weight | 1755.65 | |
| Molecular Formula | C80H106Cl2N11O27P | |
| CAS Number | 372151-71-8 | |
| SMILES | CCCCCCCCCCNCCN[C@@]1(C)C[C@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2OC2=C3OC4=CC=C(C=C4Cl)[C@@H](O)[C@@H](NC(=O)[C@@H](CC(C)C)NC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]4C(C=C2OC2=C(Cl)C=C(C=C2)[C@@H](O)[C@@H]2NC(=O)[C@H](NC4=O)C4=CC(=C(O)C=C4)C4=C(O)C(CNCP(O)(O)=O)=C(O)C=C4[C@H](NC2=O)C(O)=O)=C3)O[C@@H](C)[C@H]1O | |
| External Links | ||
| DRUGBANK | DB06402 | |
| PubChem Compound | 3081362 | |
| PDR | 2166 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 747000.0 | ng.h/ml | 747±129 | ug.h/ml | intravenous injection, IV; | DRUGBANK |
| C Max | 93600.0 | ng/ml | 93.6±14.2 | ug/ml | intravenous injection, IV; | DRUGBANK |
| Tss | 72.0 | h | 3 | day | intravenous injection, IV; | DRUGBANK |
| Clearance | 0.0139 | L/h/kg | 13.9±2.9 | ml/h/kg | normal,healthy; | DRUGBANK | Clearance | 0.0120 | L/h/kg | 0.2 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.14 | L/kg | 0.14 | L/kg | Steady state volume of distribution; normal,healthy; | DRUGBANK | Volume of Distribution | 0.11 | L/kg | 0.11 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 8.0 | h | 8±1.5 | h | elimination half-life; normal renal function; | DRUGBANK | Half-life | 6.7 | h | 6.7 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 90.0 | % | >90 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 10.0 | mg/kg/day | 10 | mg/kg/day | intravenous injection, IV | Vibativ | telavancin | PDR |
| Max dose for elderly | 10.0 | mg/kg/day | 10 | mg/kg/day | intravenous injection, IV | Vibativ | telavancin | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1