Basic Information
| Drug ID | DDPD06401 |
|
| Drug Name | Bazedoxifene | |
| Molecular Weight | 470.613 | |
| Molecular Formula | C30H34N2O3 | |
| CAS Number | 198481-32-2 | |
| SMILES | CC1=C(N(CC2=CC=C(OCCN3CCCCCC3)C=C2)C2=C1C=C(O)C=C2)C1=CC=C(O)C=C1 | |
| External Links | ||
| DRUGBANK | DB06401 | |
| PubChem Compound | 154257 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 6.0 | % | ~6 | % | DRUGBANK | |
| T Max | 2.0 | h | 2 | h | DRUGBANK | |
| Clearance | 4.5 | L/h/kg | ~4.0-5 | l/h/kg | apparent clearance; PO, oral; | DRUGBANK | Clearance | 0.40 | L/h/kg | 6.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 14.7 | L/kg | 14.7 ± 3.9 | L/kg | intravenous injection, IV; | DRUGBANK | Volume of Distribution | 15.4 | L/kg | 15.4 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 30.0 | h | ~30 | h | DRUGBANK | Half-life | 30.0 | h | 30 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 98.5 | % | 98-99 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1