Basic Information
| Drug ID | DDPD06335 |
|
| Drug Name | Saxagliptin | |
| Molecular Weight | 315.41 | |
| Molecular Formula | C18H25N3O2 | |
| CAS Number | 361442-04-8 | |
| SMILES | [H][C@@]12C[C@]1([H])N([C@@H](C2)C#N)C(=O)[C@@H](N)C12CC3CC(CC(O)(C3)C1)C2 | |
| External Links | ||
| DRUGBANK | DB06335 | |
| PubChem Compound | 11243969 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 78.0 | ng.h/ml | 78.0 | ng.h/ml | Oral single dose; normal,healthy; | DRUGBANK | AUC | 214.0 | ng.h/ml | 214.0 | ng.h/ml | Oral single dose; Active metabolite; normal,healthy; | DRUGBANK |
| Bioavailability | 67.0 | % | 67 | % | DRUGBANK | |
| C Max | 24.0 | ng/ml | 24 | ng/ml | Oral single dose; normal,healthy; | DRUGBANK | C Max | 47.0 | ng/ml | 47 | ng/ml | Oral single dose; Active metabolite; normal,healthy; | DRUGBANK |
| T Max | 2.0 | h | 2 | h | Oral single dose; normal,healthy; | DRUGBANK | T Max | 4.0 | h | 4 | h | Oral single dose; Active metabolite; normal,healthy; | DRUGBANK |
| Metabolic | 50.0 | % | 50 | % | Liver metabolism; | DRUGBANK |
| Clearance | 14.0 | L/h | 14.0 | L/h | Renal clearance; | DRUGBANK | Clearance | 0.43 | L/h/kg | 7.1 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 151.0 | L | 151.0 | L | DRUGBANK | Volume of Distribution | 1.8 | L/kg | 1.8 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.5 | h | 2.5 | h | DRUGBANK | Half-life | 3.1 | h | 3.1 | h | DRUGBANK | Half-life | 7.5 | h | 7.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 22.0 | % | 22 | % | Faeces excretion; Single dose; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1