Basic Information
| Drug ID | DDPD06292 |
|
| Drug Name | Dapagliflozin | |
| Molecular Weight | 408.873 | |
| Molecular Formula | C21H25ClO6 | |
| CAS Number | 461432-26-8 | |
| SMILES | CCOC1=CC=C(CC2=C(Cl)C=CC(=C2)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C1 | |
| External Links | ||
| DRUGBANK | DB06292 | |
| PubChem Compound | 9887712 | |
| PDR | 3427 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 2.7 | - | 2.7 | - | [MSDS] |
| Boiling Point | 609.0 | ℃ | 609 | ℃ | [MSDS] |
| Melting Point | 65.0 | ℃ | 65 | ℃ | [MSDS] |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 78.0 | % | 78 | % | PO, oral; | DRUGBANK | |
| T Max | 1.0 | h | 1 | h | PO, oral; patients; fasting; | DRUGBANK | T Max | 2.0 | h | 2 | h | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| Clearance | 0.29 | L/h/kg | 4.9 | ml/min/kg | Plasma clearance; PO, oral; | DRUGBANK | Clearance | 0.34 | L/h | 5.6 | ml/min | Renal clearance; PO, oral; | DRUGBANK | Clearance | 0.18 | L/h/kg | 3 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 118.0 | L | 118.0 | L | DRUGBANK | Volume of Distribution | 1.7 | L/kg | 1.7 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 13.8 | h | 13.8 | h | DRUGBANK | Half-life | 12.2 | h | 12.2 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 75.2 | % | 75.2 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 21.0 | % | 21 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 91.0 | % | 91 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 10.0 | mg/day | 10 | mg/day | PO, oral | Farxiga | dapagliflozin | PDR |
| Max dose for geriatric | 10.0 | mg/day | 10 | mg/day | PO, oral | Farxiga | dapagliflozin | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1