Basic Information
| Drug ID | DDPD06287 |
|
| Drug Name | Temsirolimus | |
| Molecular Weight | 1030.2871 | |
| Molecular Formula | C56H87NO16 | |
| CAS Number | 162635-04-3 | |
| SMILES | OCC(C)(CO)C(=O)O[C@@H]1CC[C@@H](C[C@@H](C)[C@]2([H])CC(=O)[C@H](C)\C=C(C)\[C@@H](O)[C@@H](OC)C(=O)[C@H](C)C[C@H](C)\C=C\C=C\C=C(C)\[C@@H](OC)C[C@]3([H])CC[C@@H](C)[C@@](O)(O3)C(=O)C(=O)N3CCCC[C@H]3C(=O)O2)C[C@H]1OC | |
| External Links | ||
| DRUGBANK | DB06287 | |
| PubChem Compound | 23724530 | |
| PDR | 626 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 0.75 | h | 0.5-1 | h | intravenous infusion, IV in drop; | DRUGBANK |
| Clearance | 16.2 | L/h | 16.2 | L/h | DRUGBANK | Clearance | 0.46 | L/h/kg | 7.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 172.0 | L | 172.0 | L | tumor; patients; | DRUGBANK | Volume of Distribution | 3.0 | L/kg | 3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 17.3 | h | 17.3 | h | DRUGBANK | Half-life | 54.6 | h | 54.6 | h | DRUGBANK | Half-life | 18.0 | h | 18 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 76.0 | % | 76 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 4.6 | % | 4.6 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 87.0 | % | 87 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 3.57142857142857 | mg/day | 25 | mg/week | intravenous injection, IV | qw | Torisel | temsirolimus | PDR |
| Max dose for geriatric | 3.57142857142857 | mg/day | 25 | mg/week | intravenous injection, IV | qw | Torisel | temsirolimus | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1