Basic Information
| Drug ID | DDPD06283 |
|
| Drug Name | Ziconotide | |
| Molecular Weight | N.A. | |
| Molecular Formula | N.A. | |
| CAS Number | 107452-89-1 | |
| SMILES | CC1C(=O)NC(C(=O)NC2CSSCC3C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(CSSCC(C(=O)NC(CSSCC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)N1)CCCCN)CCCCN)N)C(=O)NC(C(=O)NCC(=O)NC(C(=O)N3)CO)C(C)O)NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC2=O)CO)CCCNC(=N)N)CC(C)C)CCSC)CC4=CC=C(C=C4)O)CC(=O)O)C(=O)N)CCCCN)CO)CCCNC(=N)N)CCCCN | |
| External Links | ||
| DRUGBANK | DB06283 | |
| PubChem Compound | 16135415 | |
| PDR | 782 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 345.8 | ng.h/ml | 83.6-608 | ng.h/ml | intrathecal administration; | DRUGBANK |
| C Max | 74.2 | ng/ml | 16.4-132 | ng/ml | intrathecal administration; | DRUGBANK |
| Clearance | 0.0228 | L/h | 0.38 ± 0.56 | ml/min | DRUGBANK | Clearance | 16.2 | L/h | 270 ± 44 | ml/min | Plasma clearance; | DRUGBANK | Clearance | 0.24 | L/h/kg | 4.05 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.16 | L | 155 ± 263 | mL | Apparent volume of distribution; patients; | DRUGBANK | Volume of Distribution | 30.5 | L | 30460±6366 | mL | Apparent volume of distribution; intravenous injection, IV; | DRUGBANK | Volume of Distribution | 0.43 | L/kg | 0.43 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 4.6 | h | 4.6±0.9 | h | elimination half-life; intrathecal administration; patients; | DRUGBANK | Half-life | 1.3 | h | 1.3±0.3 | h | elimination half-life; intravenous injection, IV; | DRUGBANK | Half-life | 1.3 | h | 1.3 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; intravenous injection, IV; | DRUGBANK |
| Protein Binding | 50.0 | % | ~50 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 0.0192 | mg/day | 19.2 | mcg/day | intrathecal administration | Prialt | ziconotide | PDR |
| Max dose for adults | 0.0192 | mg/day | 0.8 | mcg/h | intrathecal administration | Prialt | ziconotide | PDR |
| Max dose for elderly | 0.0192 | mg/day | 19.2 | mcg/day | intrathecal administration | Prialt | ziconotide | PDR |
| Max dose for elderly | 0.0192 | mg/day | 0.8 | mcg/hour | intrathecal administration | Prialt | ziconotide | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1