Basic Information
| Drug ID | DDPD06230 |
|
| Drug Name | Nalmefene | |
| Molecular Weight | 339.435 | |
| Molecular Formula | C21H25NO3 | |
| CAS Number | 55096-26-9 | |
| SMILES | [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(CC3CC3)[C@]([H])(C4)[C@]1(O)CCC2=C | |
| External Links | ||
| DRUGBANK | DB06230 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Water Solubility | 130000.0 | mg/L | 130 | mg/ml | FDA Label |
| pKa | 7.6 | - | 7.6 | - | FDA Label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| AUC | 131.0 | ng.h/ml | 131.0 | ng.h/ml | Oral single dose; | DRUGBANK | |
| AUC | 183.4 | ng.h/ml | 170.3-196.5 | ng.h/ml | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| Bioavailability | 41.0 | % | 41 | % | PO, oral; | DRUGBANK | |
| Bioavailability | 40.0 | % | 40.0 | % | PO, oral; normal,healthy; | The Pharmacological Basis of Therapeutics | |
| C Max | 16.5 | ng/ml | 16.5 | ng/ml | Oral single dose; | DRUGBANK | |
| C Max | 23.1 | ng/ml | 21.45-24.75 | ng/ml | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| C Max | 24.0 | ng/ml | 24±11 | ng/ml | Oral single dose; Male, men; normal,healthy; | The Pharmacological Basis of Therapeutics | |
| C Max | 17.0 | ng/ml | 17±6.3 | ng/ml | Male, men; normal,healthy; | The Pharmacological Basis of Therapeutics | |
| T Max | 1.5 | h | 1.5 | h | Oral single dose; | DRUGBANK | |
| T Max | 2.0 | h | 2 | h | PO, oral; high-fat meal; | high-fat meal ↑ ; | DRUGBANK |
| T Max | 1.9 | h | 1.5-2.3 | h | IM,intramuscular injection; | DRUGBANK | |
| T Max | 1.9 | h | 1.5-2.3 | h | subcutaneous injection, SC; | DRUGBANK | |
| T Max | 2.5 | h | 2.5±0.58 | h | Oral single dose; Male, men; normal,healthy; | The Pharmacological Basis of Therapeutics | |
| Clearance | 16.0 | L/h | 16.0 | L/h | PO, oral; | DRUGBANK | |
| Clearance | 0.80 | L/h/kg | 0.8±0.2 | L/h/kg | Total clearance; intravenous injection, IV; normal,healthy; Male, men; | DRUGBANK | |
| Clearance | 0.0800 | L/h/kg | 0.08±0.04 | L/h/kg | Renal clearance; intravenous injection, IV; normal,healthy; Male, men; | DRUGBANK | |
| Clearance | 0.90 | L/h/kg | 15±4.5 | ml/min/kg | normal,healthy; adults; Male, men; Female, women; metabolism of ugt; | hepatopathy，LD ↓ ;RD, renal impairment, Renal disease，including uremia ↓ ; | The Pharmacological Basis of Therapeutics |
| Clearance | 0.90 | L/h/kg | 15 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 3200.0 | L | ~3200 | L | PO, oral; | DRUGBANK | |
| Volume of Distribution | 3.9 | L/kg | 3.9±1.1 | L/kg | Total volume of distribution; | DRUGBANK | |
| Volume of Distribution | 8.6 | L/kg | 8.6±1.7 | L/kg | Steady state volume of distribution; | DRUGBANK | |
| Volume of Distribution | 8.0 | L/kg | 8.0±1.8 | L/kg | normal,healthy; adults; Male, men; Female, women; metabolism of ugt; | RD, renal impairment, Renal disease，including uremia ↑ ; | The Pharmacological Basis of Therapeutics |
| Volume of Distribution | 8.2 | L/kg | 8.2 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Half-life | 12.5 | h | 12.5 | h | PO, oral; | DRUGBANK | |
| Half-life | 10.8 | h | 10.8±5.2 | h | terminal half-life; adults; Male, men; intravenous injection, IV; | DRUGBANK | |
| Half-life | 8.0 | h | 8.0±2.2 | h | normal,healthy; adults; Male, men; Female, women; | moderate hepatic impairment ↑ ;severe hepatic impairment ↑ ;RD, renal impairment, Renal disease，including uremia ↑ ; | The Pharmacological Basis of Therapeutics |
| Half-life | 8.8 | h | 8.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Eliminate Route | 17.0 | % | ~17 | % | Faeces excretion; | DRUGBANK | |
| Eliminate Route | 9.6 | % | 9.6±4.9 | % | Urinary excretion; adults; normal,healthy; human, homo sapiens; Unchanged drug; | The Pharmacological Basis of Therapeutics | |
| Protein Binding | 37.5 | % | 30-45 | % | plasma proteins; | DRUGBANK | |
| Protein Binding | 34.4 | % | 34.4±13.6 | % | adults; normal,healthy; human, homo sapiens; | The Pharmacological Basis of Therapeutics |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1