| Drug ID | DDPD06216 |
|
| Drug Name | Asenapine | |
| Molecular Weight | 401.84 | |
| Molecular Formula | C21H20ClNO5 | |
| CAS Number | 65576-45-6 | |
| SMILES | OC(=O)\C=C/C(O)=O.CN1CC2C(C1)C1=C(OC3=CC=CC=C23)C=CC(Cl)=C1 | |
| External Links | ||
| DRUGBANK | DB06216 | |
| PubChem Compound | 11954293 | |
| PDR | 387 | |
| Drugs.com | Drugs.com Drug Page | |
Not Available
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 35.0 | % | 35 | % | sublingual; | DRUGBANK | Bioavailability | 2.0 | % | <2% | % | PO, oral; | DRUGBANK |
| C Max | 4.0 | ng/ml | 4 | ng/ml | DRUGBANK | |
| T Max | 1.0 | h | <1 | h | DRUGBANK | T Max | 1.0 | h | 0.5-1.5 | h | DRUGBANK |
| Tss | 72.0 | h | 3 | day | DRUGBANK | |
| Clearance | 0.74 | L/h/kg | 12.4 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 22.5 | L/kg | 20-25 | L/kg | DRUGBANK | Volume of Distribution | 23.0 | L/kg | 23 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 24.0 | h | 24(13.4-39.2) | h | DRUGBANK | |
| Eliminate Route | 50.0 | % | 50 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 50.0 | % | 50 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 95.0 | % | 95 | % | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 20.0 | mg/day | 20 | mg/day | sublingual | Saphris | asenapine | PDR |
| Max dose for adolescents | 20.0 | mg/day | 20 | mg/day | sublingual | Saphris | asenapine | PDR |
| Max dose for adults | 20.0 | mg/day | 20 | mg/day | sublingual | Saphris | asenapine | PDR |
| Max dose for adults | 7.6 | mg/day | 7.6 | mg/day | skin/dermal | Saphris | asenapine | PDR |
| Max dose for geriatric | 20.0 | mg/day | 20 | mg/day | sublingual | Saphris | asenapine | PDR |
| Max dose for geriatric | 7.6 | mg/day | 7.6 | mg/day | skin/dermal | Saphris | asenapine | PDR |