Basic Information
| Drug ID | DDPD06212 |
|
| Drug Name | Tolvaptan | |
| Molecular Weight | 448.941 | |
| Molecular Formula | C26H25ClN2O3 | |
| CAS Number | 150683-30-0 | |
| SMILES | CC1=CC=CC=C1C(=O)NC1=CC(C)=C(C=C1)C(=O)N1CCC[C@@H](O)C2=C1C=CC(Cl)=C2 | |
| External Links | ||
| DRUGBANK | DB06212 | |
| PubChem Compound | 443894 | |
| PDR | 24201 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 4550.0 | ng.h/ml | 4.55 | ug.h/ml | DRUGBANK | |
| C Max | 374.0 | ng/ml | 374 | ng/ml | DRUGBANK | C Max | 418.0 | ng/ml | 418 | ng/ml | DRUGBANK | C Max | 460.0 | ng/ml | 460 | ng/ml | heart failure; | DRUGBANK | C Max | 723.0 | ng/ml | 723 | ng/ml | heart failure; | DRUGBANK |
| T Max | 3.0 | h | 2-4 | h | DRUGBANK | |
| Clearance | 0.24 | L/h/kg | 4.0 | ml/min/kg | DRUGBANK | Clearance | 0.14 | L/h/kg | 2.4 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 3.0 | L/kg | 3.0 | L/kg | normal,healthy; | DRUGBANK | Volume of Distribution | 0.50 | L/kg | 0.5 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 12.0 | h | 12 | h | terminal half-life; PO, oral; | DRUGBANK | Half-life | 2.9 | h | 2.9 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 2000.0 | mg/kg | >2000 | mg/kg | PO, oral; Rattus, Rat; dog; | DRUGBANK |
| Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 60.0 | mg/day | 60 | mg/day | PO, oral; up to 30 days | Jynarque | tolvaptan | PDR |
| Max dose for adults | 120.0 | mg/day | 120 | mg/day | PO, oral | Jynarque | tolvaptan | PDR |
| Max dose for geriatric | 60.0 | mg/day | 60 | mg/day | PO, oral; up to 30 days | Jynarque | tolvaptan | PDR |
| Max dose for geriatric | 120.0 | mg/day | 120 | mg/day | PO, oral | Jynarque | tolvaptan | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1