Basic Information
| Drug ID | DDPD06202 |
|
| Drug Name | Lasofoxifene | |
| Molecular Weight | 413.5512 | |
| Molecular Formula | C28H31NO2 | |
| CAS Number | 180916-16-9 | |
| SMILES | [H][C@@]1(CCC2=CC(O)=CC=C2[C@@]1([H])C1=CC=C(OCCN2CCCC2)C=C1)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB06202 | |
| PubChem Compound | 216416 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 62.0 | % | 62 | % | Rattus, Rat; | DRUGBANK |
| T Max | 6.7 | h | 6-7.3 | h | DRUGBANK | |
| Clearance | 6.6 | L/h | ~6.6 | L/h | apparent clearance; PO, oral; Female, women; | DRUGBANK |
| Volume of Distribution | 1350.0 | L | 1350.0 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 144.0 | h | ~6 | day | elimination half-life; | DRUGBANK |
| Eliminate Route | 2.0 | % | <2 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.0 | % | >99 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1