Basic Information
| Drug ID | DDPD06201 |
|
| Drug Name | Rufinamide | |
| Molecular Weight | 238.1935 | |
| Molecular Formula | C10H8F2N4O | |
| CAS Number | 106308-44-5 | |
| SMILES | NC(=O)C1=CN(CC2=C(F)C=CC=C2F)N=N1 | |
| External Links | ||
| DRUGBANK | DB06201 | |
| PubChem Compound | 129228 | |
| PDR | 139 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 0.835 | - | 0.835 | - | MSDS |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Absorption | 85.0 | % | >85 | % | Oral single dose; food; | DRUGBANK | |
| AUC | 37800.0 | ng.h/ml | 37.8±47 | ug.h/ml | PO, oral; | DRUGBANK | AUC | 89300.0 | ng.h/ml | 89.3±59 | ug.h/ml | PO, oral; | DRUGBANK |
| Bioavailability | 77.5 | % | 70-85 | % | PO, oral; increasing doses; | increasing doses ↓ ; | DRUGBANK |
| C Max | 4010.0 | ng/ml | 4.01 | ug/ml | PO, oral; | DRUGBANK | C Max | 8680.0 | ng/ml | 8.68 | ug/ml | PO, oral; | DRUGBANK |
| T Max | 5.0 | h | 4-6 | h | PO, oral; food; fasting; | DRUGBANK | |
| Volume of Distribution | 50.0 | L | 50.0 | L | Apparent volume of distribution; | DRUGBANK | |
| Half-life | 8.0 | h | 6-10 | h | elimination half-life; normal,healthy; | DRUGBANK | Half-life | 8.0 | h | 6-10 | h | elimination half-life; epilepsy; patients; | DRUGBANK |
| Eliminate Route | 91.0 | % | 91 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 9.0 | % | 9 | % | Faeces excretion; | DRUGBANK |
| Protein Binding | 30.6 | % | 26.3-34.8 | % | DRUGBANK | Protein Binding | 27.0 | % | 27 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 45.0 | mg/kg/day | 45 | mg/kg/day | PO, oral | Banzel | rufinamide | PDR |
| Max dose for children | 3200.0 | mg/day | 3200 | mg/day | PO, oral | Banzel | rufinamide | PDR |
| Max dose for adolescents | 3200.0 | mg/day | 3200 | mg/day | PO, oral | Banzel | rufinamide | PDR |
| Max dose for adolescents | 45.0 | mg/kg/day | 45 | mg/kg/day | PO, oral | Banzel | rufinamide | PDR |
| Max dose for adolescents | 3200.0 | mg/day | 3200 | mg/day | PO, oral | Banzel | rufinamide | PDR |
| Max dose for adults | 3200.0 | mg/day | 3200 | mg/day | PO, oral | Banzel | rufinamide | PDR |
| Max dose for geriatric | 3200.0 | mg/day | 3200 | mg/day | PO, oral | Banzel | rufinamide | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1