Basic Information
| Drug ID | DDPD06145 |
|
| Drug Name | Spiramycin | |
| Molecular Weight | 843.065 | |
| Molecular Formula | C43H74N2O14 | |
| CAS Number | 24916-50-5 | |
| SMILES | CO[C@H]1[C@H](O)CC(=O)O[C@H](C)C\C=C\C=C\[C@H](O[C@H]2CC[C@@H]([C@H](C)O2)N(C)C)[C@H](C)C[C@H](CC=O)[C@@H]1O[C@@H]1O[C@H](C)[C@@H](O[C@H]2C[C@@](C)(O)[C@@H](O)[C@H](C)O2)[C@@H]([C@H]1O)N(C)C | |
| External Links | ||
| DRUGBANK | DB06145 | |
| PubChem Compound | 6440717 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 34.5 | % | 30-39 | % | DRUGBANK | |
| Clearance | 0.77 | L/h/kg | 12.8 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 300.0 | L | >300 | L | DRUGBANK | Volume of Distribution | 5.4 | L/kg | 5.4 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 5.4 | h | ~4.5-6.2 | h | young; intravenous injection, IV; | DRUGBANK | Half-life | 11.7 | h | ~9.8-13.5 | h | Elderly; intravenous injection, IV; | DRUGBANK | Half-life | 6.8 | h | 5.5-8 | h | PO, oral; | DRUGBANK | Half-life | 8.0 | h | 8 | h | Children; Rectal Administration; | DRUGBANK | Half-life | 5.2 | h | 5.2 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 17.5 | % | 10-25 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1