Basic Information
| Drug ID | DDPD06119 |
|
| Drug Name | Cenobamate | |
| Molecular Weight | 267.67 | |
| Molecular Formula | C10H10ClN5O2 | |
| CAS Number | 913088-80-9 | |
| SMILES | NC(=O)O[C@@H](CN1N=CN=N1)C1=C(Cl)C=CC=C1 | |
| External Links | ||
| DRUGBANK | DB06119 | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 0.456 | - | 0.456 | - | ChemSpider |
| Water Solubility | 1700.0 | mg/L | 1.7 | mg/ml | FDA Label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 88.0 | % | 88 | % | PO, oral; high-fat meal; | high-fat meal → ; | DRUGBANK |
| T Max | 2.5 | h | 1-4 | h | PO, oral; high-fat meal; | high-fat meal → ; | DRUGBANK |
| Clearance | 0.54 | L/h | 0.45-0.63 | L/h | apparent clearance; PO, oral; | DRUGBANK | |
| Volume of Distribution | 45.0 | L | 40-50 | L | Apparent volume of distribution; | DRUGBANK | |
| Half-life | 55.0 | h | 50-60 | h | terminal half-life; | DRUGBANK | |
| Eliminate Route | 87.8 | % | 87.8 | % | Urinary excretion; | DRUGBANK | |
| Eliminate Route | 5.2 | % | 5.2 | % | Faeces excretion; | DRUGBANK | |
| Protein Binding | 60.0 | % | 60 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1