Basic Information
| Drug ID | DDPD05271 |
|
| Drug Name | Rotigotine | |
| Molecular Weight | 315.48 | |
| Molecular Formula | C19H25NOS | |
| CAS Number | 99755-59-6 | |
| SMILES | CCCN(CCC1=CC=CS1)[C@H]1CCC2=C(O)C=CC=C2C1 | |
| External Links | ||
| DRUGBANK | DB05271 | |
| PubChem Compound | 59227 | |
| PDR | 2468 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.7 | - | 4.7 | - | BIOBYTE STARLIST (2009) |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 16.5 | h | 15-18 | h | DRUGBANK | |
| Tss | 60.0 | h | 2-3 | day | DRUGBANK | |
| Clearance | 2.2 | L/h/kg | 37 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 84.0 | L/kg | 84.0 | L/kg | Steady state volume of distribution; Multiple dose; | DRUGBANK | Volume of Distribution | 5.7 | L/kg | 5.7 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 6.0 | h | 5-7 | h | terminal half-life; | DRUGBANK | Half-life | 3.0 | h | 3 | h | distribution half-life; | DRUGBANK | Half-life | 4.0 | h | 4 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 71.0 | % | 71 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 23.0 | % | 23 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 7.1 | % | <7.1 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 92.0 | % | 92 | % | high protein binding; | DRUGBANK | Protein Binding | 89.5 | % | 89.5 | % | in vivo; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 8.0 | mg/day | 8 | mg/day | Transdermal preparations | Neupro | rotigotine | PDR |
| Max dose for adults | 3.0 | mg/day | 3 | mg/day | Transdermal preparations | Neupro | rotigotine | PDR |
| Max dose for geriatric | 8.0 | mg/day | 8 | mg/day | Transdermal preparations | Neupro | rotigotine | PDR |
| Max dose for geriatric | 3.0 | mg/day | 3 | mg/day | Transdermal preparations | Neupro | rotigotine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1