Basic Information
| Drug ID | DDPD04946 |
|
| Drug Name | Iloperidone | |
| Molecular Weight | 426.4806 | |
| Molecular Formula | C24H27FN2O4 | |
| CAS Number | 133454-47-4 | |
| SMILES | COC1=C(OCCCN2CCC(CC2)C2=NOC3=C2C=CC(F)=C3)C=CC(=C1)C(C)=O | |
| External Links | ||
| DRUGBANK | DB04946 | |
| PubChem Compound | 71360 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 3.0 | h | 2-4 | h | DRUGBANK | |
| Tss | 84.0 | h | 3-4 | day | DRUGBANK | |
| Clearance | 74.5 | L/h | 47-102 | L/h | apparent clearance; | DRUGBANK |
| Volume of Distribution | 2070.0 | L | 1340-2800 | L | Apparent volume of distribution; | DRUGBANK |
| Half-life | 18.0 | h | 18 | h | elimination half-life; extensive metabolizers, EM; | DRUGBANK | Half-life | 26.0 | h | 26 | h | elimination half-life; extensive metabolizers, EM; | DRUGBANK | Half-life | 23.0 | h | 23 | h | elimination half-life; extensive metabolizers, EM; | DRUGBANK | Half-life | 33.0 | h | 33 | h | elimination half-life; poor metabolizers, PM; | DRUGBANK | Half-life | 37.0 | h | 37 | h | elimination half-life; poor metabolizers, PM; | DRUGBANK | Half-life | 31.0 | h | 31 | h | elimination half-life; poor metabolizers, PM; | DRUGBANK |
| Eliminate Route | 1.0 | % | <1 | % | Unchanged drug; | DRUGBANK |
| Protein Binding | 95.0 | % | 95 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1