Basic Information
| Drug ID | DDPD04865 |
|
| Drug Name | Omacetaxine mepesuccinate | |
| Molecular Weight | 545.6213 | |
| Molecular Formula | C29H39NO9 | |
| CAS Number | 26833-87-4 | |
| SMILES | [H][C@@]1(OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)OC)C(OC)=C[C@]23CCCN2CCC2=CC4=C(OCO4)C=C2[C@]13[H] | |
| External Links | ||
| DRUGBANK | DB04865 | |
| PubChem Compound | 285033 | |
| PDR | 3020 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 0.50 | h | 30 | min | DRUGBANK | |
| Metabolic | 0 | % | 0 | % | Liver metabolism; | DRUGBANK |
| Volume of Distribution | 141.0 | L | 141±93.4 | L | Steady state volume of distribution; | DRUGBANK |
| Half-life | 6.0 | h | ~6 | h | subcutaneous injection, SC; | DRUGBANK |
| Eliminate Route | 15.0 | % | <15 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 50.0 | % | ≤50 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 2.5 | mg/m2/day | 2.5 | mg/m2/day | subcutaneous injection, SC | Synribo | omacetaxine mepesuccinate | PDR |
| Max dose for geriatric | 2.5 | mg/m2/day | 2.5 | mg/m2/day | subcutaneous injection, SC | Synribo | omacetaxine mepesuccinate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1