Basic Information
| Drug ID | DDPD04861 |
|
| Drug Name | Nebivolol | |
| Molecular Weight | 405.435 | |
| Molecular Formula | C22H25F2NO4 | |
| CAS Number | 118457-14-0 | |
| SMILES | OC(CNCC(O)C1CCC2=C(O1)C=CC(F)=C2)C1CCC2=C(O1)C=CC(F)=C2 | |
| External Links | ||
| DRUGBANK | DB04861 | |
| PubChem Compound | 71301 | |
| PDR | 156 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.183 | - | 4.183 | - | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=CA&language=en&productNumber=N1915&brand=SIGMA&PageToGoToURL=https%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fproduct%2Fsigma%2Fn1915%3Flang%3Den |
| Melting Point | 225.5 | ℃ | 223.0-228.0 | ℃ | https://www.tcichemicals.com/eshop/en/gb/commodity/N0954/ |
| Water Solubility | 910.0 | mg/L | 0.091 | g/100ml | http://www.medicines.org.au/files/txpnebiv.pdf |
| pKa | 8.13 | - | 8.13 | - | http://www.medicines.org.au/files/txpnebiv.pdf |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 13.8 | ng.h/ml | 13.78±15.27 | ng.h/ml | Raceme D; | DRUGBANK |
| AUC | 27.7 | ng.h/ml | 27.72±15.32 | ng.h/ml | Raceme L; | DRUGBANK |
| AUC | 41.5 | ng.h/ml | 41.50±29.76 | ng.h/ml | Raceme D/L; | DRUGBANK |
| AUC | 396.8 | ng.h/ml | 396.78±297.94 | ng.h/ml | Derivative; | DRUGBANK |
| Bioavailability | 54.0 | % | 12-96 | % | PO, oral; poor metabolizers, PM; extensive metabolizers, EM; | DRUGBANK |
| C Max | 2.8 | ng/ml | 2.75±1.55 | ng/ml | Raceme D; | DRUGBANK |
| C Max | 5.3 | ng/ml | 5.29±2.06 | ng/ml | Raceme L; | DRUGBANK |
| C Max | 8.0 | ng/ml | 8.02±3.47 | ng/ml | Raceme D/L; | DRUGBANK |
| C Max | 68.3 | ng/ml | 68.34±44.68 | ng/ml | Derivative; | DRUGBANK |
| T Max | 2.8 | h | 1.5-4 | h | PO, oral; poor metabolizers, PM; extensive metabolizers, EM; | DRUGBANK |
| Clearance | 1241.6 | L/h | 1241.63±749.77 | L/h | DRUGBANK | |
| Clearance | 435.5 | L/h | 435.53±180.93 | L/h | DRUGBANK | |
| Clearance | 635.3 | L/h | 635.31±300.25 | L/h | DRUGBANK | |
| Clearance | 0.84 | L/h/kg | 14 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 10290.8 | L | 10290.81±3911.72 | L | Apparent volume of distribution; | DRUGBANK |
| Volume of Distribution | 8066.7 | L | 8066.66±4055.50 | L | Apparent volume of distribution; | DRUGBANK |
| Volume of Distribution | 10423.4 | L | 10423.42±6796.50 | L | Apparent volume of distribution; | DRUGBANK |
| Volume of Distribution | 11.0 | L/kg | 11 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 12.0 | h | 12 | h | Raceme D; extensive metabolizers, EM; | DRUGBANK |
| Half-life | 19.0 | h | 19 | h | Raceme D; poor metabolizers, PM; | DRUGBANK |
| Half-life | 10.0 | h | 10 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 38.0 | % | 38 | % | Urinary excretion; extensive metabolizers, EM; | DRUGBANK |
| Eliminate Route | 44.0 | % | 44 | % | Faeces excretion; extensive metabolizers, EM; | DRUGBANK |
| Eliminate Route | 67.0 | % | 67 | % | Urinary excretion; poor metabolizers, PM; | DRUGBANK |
| Eliminate Route | 13.0 | % | 13 | % | Faeces excretion; poor metabolizers, PM; | DRUGBANK |
| Protein Binding | 98.0 | % | 98 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 40.0 | mg/day | 40 | mg/day | PO, oral | Bystolic | nebivolol | PDR |
| Max dose for elderly | 40.0 | mg/day | 40 | mg/day | PO, oral | Bystolic | nebivolol | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1