| Drug ID | DDPD04846 |
|
| Drug Name | Celiprolol | |
| Molecular Weight | 379.501 | |
| Molecular Formula | C20H33N3O4 | |
| CAS Number | 56980-93-9 | |
| SMILES | CCN(CC)C(=O)NC1=CC=C(OCC(O)CNC(C)(C)C)C(=C1)C(C)=O | |
| External Links | ||
| DRUGBANK | DB04846 | |
| PubChem Compound | 2663 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Melting Point | 121.0 | ℃ | 120-122 | ℃ | Zolss, G., Pittner, H., Stormann-Menninger-Lerchenthal, H. and Lindner, I.; US. Patent 3,983,169; September 28,1976; assigned to Chemie Linz AG (Austria). |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 55.0 | % | 55 | % | DRUGBANK | Absorption | 74.0 | % | 74 | % | DRUGBANK |
| T Max | 2.5 | h | 2-3 | h | PO, oral; | DRUGBANK |
| Metabolic | 2.0 | % | 1-3 | % | Liver metabolism; | DRUGBANK |
| Volume of Distribution | 4.5 | L/kg | 4.5 | L/kg | DRUGBANK | |
| Half-life | 5.0 | h | 5 | h | DRUGBANK | |
| Protein Binding | 27.5 | % | 25-30 | % | DRUGBANK |
Not Available