Basic Information
| Drug ID | DDPD01413 |
|
| Drug Name | Cefepime | |
| Molecular Weight | 480.561 | |
| Molecular Formula | C19H24N6O5S2 | |
| CAS Number | 88040-23-7 | |
| SMILES | CO\N=C(/C(=O)N[C@@H]1C(=O)N2[C@]1([H])SCC(C[N+]1(C)CCCC1)=C2C([O-])=O)C1=CSC(N)=N1 | |
| External Links | ||
| DRUGBANK | DB01413 | |
| PubChem Compound | 5479537 | |
| PDR | 3215 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 82.3 | % | 82.3±15 | % | IM,intramuscular injection; patients; | DRUGBANK | |
| C Max | 65000.0 | ng/ml | 65±7 | mcg/ml | intravenous injection, IV; | The Pharmacological Basis of Therapeutics | |
| Clearance | 7.2 | L/h | 120.0 | ml/min | intravenous infusion, IV in drop; Single dose; normal,healthy; adults; Male, men; | DRUGBANK | Clearance | 0.20 | L/h/kg | 3.3±1.0 | ml/min/kg | intravenous injection, IV; Single dose; pediatric patients; | DRUGBANK | Clearance | 0.11 | L/h/kg | 1.8(1.7-1.5) | ml/min/kg | apparent clearance; normal,healthy; patients; adults; | RD, renal impairment, Renal disease，including uremia ↓ ; | The Pharmacological Basis of Therapeutics | Clearance | 0.13 | L/h/kg | 2.2 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 18.0 | L | 18.0±2.0 | L | DRUGBANK | Volume of Distribution | 0.30 | L/kg | 0.3±0.1 | L/kg | pediatric patients; | DRUGBANK | Volume of Distribution | 0.26 | L/kg | 0.26(0.24-0.31) | L/kg | Apparent volume of distribution; Oral single dose; normal,healthy; patients; adults; | The Pharmacological Basis of Therapeutics | Volume of Distribution | 0.28 | L/kg | 0.28 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.0 | h | 2.0±0.3 | h | normal,healthy; patients; | DRUGBANK | Half-life | 1.4 | h | 1.35±2.7 | h | patients; | DRUGBANK | Half-life | 19.0 | h | 19±2 | h | patients; | DRUGBANK | Half-life | 2.1 | h | 2.1(1.3-2.4) | h | Single dose; | mild renal function ↑ ; | The Pharmacological Basis of Therapeutics | Half-life | 1.9 | h | 1.9 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 80.0 | % | 80 | % | Urinary excretion; adults; normal,healthy; patients; human, homo sapiens; Unchanged drug; | The Pharmacological Basis of Therapeutics | |
| Protein Binding | 20.0 | % | ~20 | % | DRUGBANK | Protein Binding | 17.5 | % | 16-19 | % | adults; normal,healthy; patients; human, homo sapiens; | The Pharmacological Basis of Therapeutics |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for neonates | 100.0 | mg/kg/day | 100 | mg/kg/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for neonates | 60.0 | mg/kg/day | 60 | mg/kg/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for infants | 150.0 | mg/kg/day | 150 | mg/kg/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for infants | 100.0 | mg/kg/day | 100 | mg/kg/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for infants | 150.0 | mg/kg/day | 150 | mg/kg/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for infants | 100.0 | mg/kg/day | 100 | mg/kg/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for children | 150.0 | mg/kg/day | 150 | mg/kg/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for children | 6000.0 | mg/day | 6 | g/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for children | 100.0 | mg/kg/day | 100 | mg/kg/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for children | 2000.0 | mg/day | 2 | g/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for adolescents | 150.0 | mg/kg/day | 150 | mg/kg/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for adolescents | 6000.0 | mg/day | 6 | g/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for adolescents | 100.0 | mg/kg/day | 100 | mg/kg/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for adolescents | 2000.0 | mg/day | 2 | g/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for adults | 6000.0 | mg/day | 6 | g/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for adults | 2000.0 | mg/day | 2 | g/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
| Max dose for geriatric | 6000.0 | mg/day | 6 | g/day | intravenous injection, IV | Maxipime | cefepime hydrochloride | PDR |
| Max dose for geriatric | 2000.0 | mg/day | 2 | g/day | IM,intramuscular injection | Maxipime | cefepime hydrochloride | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1