Basic Information
| Drug ID | DDPD01409 |
|
| Drug Name | Tiotropium | |
| Molecular Weight | 392.512 | |
| Molecular Formula | C19H22NO4S2 | |
| CAS Number | 186691-13-4 | |
| SMILES | [H][C@]12O[C@@]1([H])[C@]1([H])C[C@@]([H])(C[C@@]2([H])[N+]1(C)C)OC(=O)C(O)(C1=CC=CS1)C1=CC=CS1 | |
| External Links | ||
| DRUGBANK | DB01409 | |
| PubChem Compound | 5487427 | |
| PDR | 101 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 33.0 | % | 33 | % | inhalation, IH; | DRUGBANK |
| Bioavailability | 2.5 | % | 2-3 | % | Liquid; | DRUGBANK | Bioavailability | 19.5 | % | 19.5 | % | inhalation, IH; | DRUGBANK |
| T Max | 0.10 | h | 5-7 | min | nasal spray; | DRUGBANK |
| Metabolic | 74.0 | % | 74 | % | Urinary excretion; Unchanged drug; intravenous injection, IV; | DRUGBANK |
| Clearance | 52.8 | L/h | 880.0 | ml/min | Total clearance; normal,healthy; | DRUGBANK | Clearance | 40.1 | L/h | 669.0 | ml/min | Renal clearance; | DRUGBANK | Clearance | 21.9 | L/h | 365.0 | ml/min | adults; | DRUGBANK | Clearance | 16.3 | L/h | 271.0 | ml/min | Elderly; | DRUGBANK | Clearance | 0.76 | L/h/kg | 12.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 32.0 | L/kg | 32.0 | L/kg | DRUGBANK | Volume of Distribution | 32.0 | L/kg | 32 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 24.0 | h | 24 | h | terminal half-life; COPD, Chronic obstructive pulmonary disease; patients; | DRUGBANK | Half-life | 44.0 | h | 44 | h | terminal half-life; asthma; patients; | DRUGBANK |
| Eliminate Route | 14.0 | % | 14 | % | Urinary excretion; inhalation, IH; Unchanged drug; | DRUGBANK |
| Protein Binding | 72.0 | % | 72 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.0025 | mg/day | 2.5 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for adolescents | 0.0025 | mg/day | 2.5 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for adults | 0.0025 | mg/day | 2.5 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for adults | 0.005 | mg/day | 5 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for adults | 0.018 | mg/day | 18 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for geriatric | 0.0025 | mg/day | 2.5 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for geriatric | 0.005 | mg/day | 5 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
| Max dose for geriatric | 0.018 | mg/day | 18 | mcg/day | inhalation, IH | Spiriva | tiotropium bromide | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1