| Drug ID | DDPD01395 |
|
| Drug Name | Drospirenone | |
| Molecular Weight | 366.4932 | |
| Molecular Formula | C24H30O3 | |
| CAS Number | 67392-87-4 | |
| SMILES | [H][C@@]12C[C@]1([H])[C@@]1([H])[C@]3([H])[C@]4([H])C[C@]4([H])[C@@]4(CCC(=O)O4)[C@@]3(C)CC[C@]1([H])[C@@]1(C)CCC(=O)C=C21 | |
| External Links | ||
| DRUGBANK | DB01395 | |
| PubChem Compound | 68873 | |
| PDR | 24351 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.08 | - | 3.08 | - | https://pdf.hres.ca/dpd_pm/00042999.PDF |
| Boiling Point | 552.2 | ℃ | 552.2 | ℃ | https://www.lookchem.com/Drospirenone/ |
| Melting Point | 198.0 | ℃ | 196-200 | ℃ | https://www.chemicalbook.com/ChemicalProductProperty_US_CB8695608.aspx |
| pKa | -5.0 | - | -5 | - | http://www.hmdb.ca/metabolites/HMDB0015467 |
| Log S | -5.2 | - | -5.2 | - | http://www.hmdb.ca/metabolites/HMDB0015467 |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 76.0 | % | 76 | % | DRUGBANK | Bioavailability | 80.5 | % | 76-85 | % | combination drug use; | DRUGBANK |
| C Max | 73.5 | ng/ml | 60-87 | ng/ml | DRUGBANK | C Max | 21.9 | ng/ml | 21.9 | ng/ml | combination drug use; | DRUGBANK |
| T Max | 1.5 | h | 1-2 | h | DRUGBANK | T Max | 1.0 | h | 1 | h | combination drug use; | DRUGBANK |
| Clearance | 0.0810 | L/h/kg | 1.2-1.5 | ml/min/kg | Plasma clearance; | DRUGBANK |
| Volume of Distribution | 4.0 | L/kg | 4.0 | L/kg | DRUGBANK | Volume of Distribution | 4.0 | L/kg | 3.7-4.2 | L/kg | Drug combination; | DRUGBANK |
| Half-life | 30.0 | h | 30 | h | elimination half-life; | DRUGBANK | Half-life | 40.0 | h | ~40 | h | Metabolite; | DRUGBANK |
| Toxicity LD50 | 2000.0 | mg/kg | >2000 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Protein Binding | 96.0 | % | 95-97 | % | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adolescents | 4.0 | mg/day | 4 | mg/day | PO, oral | Slynd | drospirenone | PDR |
| Max dose for adults | 4.0 | mg/day | 4 | mg/day | PO, oral | Slynd | drospirenone | PDR |