Basic Information
| Drug ID | DDPD01320 |
|
| Drug Name | Fosphenytoin | |
| Molecular Weight | 362.2739 | |
| Molecular Formula | C16H15N2O6P | |
| CAS Number | 93390-81-9 | |
| SMILES | OP(O)(=O)OCN1C(=O)NC(C1=O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB01320 | |
| T3DB | T3D3036 | |
| PubChem Compound | 56339 | |
| PDR | 3925 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 0.21 | L/h/kg | 3.5 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 7.6 | L | 4.3-10.8 | L | DRUGBANK | Volume of Distribution | 0.0600 | L/kg | 0.06 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.25 | h | ~15 | min | DRUGBANK | Half-life | 0.16 | h | 0.16 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 156.0 | mg/kg | 156.0 | mg/kg | intravenous injection, IV; mouse; | DRUGBANK | Toxicity LD50 | 250.0 | mg/kg | ~250 | mg/kg | intravenous injection, IV; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 156.0 | mg/kg | 156.0 | mg/kg | intravenous injection, IV; mouse; | T3DB | Toxicity LD50 | 250.0 | mg/kg | 250.0 | mg/kg | intravenous injection, IV; Rattus, Rat; | T3DB |
| Protein Binding | 97.0 | % | 95-99 | % | plasma proteins; human, homo sapiens; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1