Basic Information
| Drug ID | DDPD01303 |
|
| Drug Name | Oxtriphylline | |
| Molecular Weight | 283.3268 | |
| Molecular Formula | C12H21N5O3 | |
| CAS Number | 4499-40-5 | |
| SMILES | C[N+](C)(C)CCO.CN1C2=C([N-]C=N2)C(=O)N(C)C1=O | |
| External Links | ||
| DRUGBANK | DB01303 | |
| PubChem Compound | 656652 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 0.0870 | L/h/kg | 1.45 | ml/kg/min | Average clearance; Children; | DRUGBANK | Clearance | 0.000650 | L/h/kg | 0.65 | ml/kg/h | Average clearance; normal,healthy; adults; | DRUGBANK |
| Volume of Distribution | 0.50 | L/kg | 0.3–0.7 | L/kg | Apparent volume of distribution; Children; adults; | DRUGBANK |
| Half-life | 7.9 | h | 3-12.8 | h | elimination half-life; normal,healthy; | DRUGBANK | Half-life | 5.5 | h | 1.5-9.5 | h | elimination half-life; Children; | DRUGBANK | Half-life | 36.5 | h | 15-58 | h | elimination half-life; Prem, premature; | DRUGBANK |
| Protein Binding | 56.0 | % | ~56 | % | plasma proteins; adults; Children; human, homo sapiens; | DRUGBANK | Protein Binding | 36.0 | % | ~36 | % | plasma proteins; Prem, premature; human, homo sapiens; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1