Basic Information
| Drug ID | DDPD01280 |
|
| Drug Name | Nelarabine | |
| Molecular Weight | 297.2673 | |
| Molecular Formula | C11H15N5O5 | |
| CAS Number | 121032-29-9 | |
| SMILES | COC1=NC(N)=NC2=C1N=CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O | |
| External Links | ||
| DRUGBANK | DB01280 | |
| PubChem Compound | 3011155 | |
| PDR | 171 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -1.0 | - | -1.0 | - | DRUGBANK |
| Melting Point | 213.0 | ℃ | 209-217 | ℃ | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 197.0 | L/h/m2 | 197±189 | L/h/m2 | refractory leukemia; adults; patients; | DRUGBANK | Clearance | 259.0 | L/h/m2 | 259±409 | L/h/m2 | refractory leukemia; pediatric patients; | DRUGBANK | Clearance | 4.9 | L/h/kg | 81 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 4.9 | L/kg | 4.9 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.50 | h | 30 | min | DRUGBANK | Half-life | 3.0 | h | 3 | h | DRUGBANK | Half-life | 0.50 | h | 0.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 25.0 | % | <25 | % | plasma proteins; high protein binding; human, homo sapiens; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for children | 650.0 | mg/m2/day | 650 | mg/m2/day | intravenous injection, IV | Arranon | nelarabine | PDR | |
| Max dose for adolescents | 650.0 | mg/m2/day | 650 | mg/m2/day | intravenous injection, IV | Arranon | nelarabine | PDR | |
| Max dose for adults | 1500.0 | mg/m2 | 1500 | mg/m2 | intravenous injection, IV | on days 1, 3, and 5 | Arranon | nelarabine | PDR |
| Max dose for geriatric | 1500.0 | mg/m2 | 1500 | mg/m2 | intravenous injection, IV; on days 1, 3, and 5 | Arranon | nelarabine | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1