Basic Information
| Drug ID | DDPD01263 |
|
| Drug Name | Posaconazole | |
| Molecular Weight | 700.7774 | |
| Molecular Formula | C37H42F2N8O4 | |
| CAS Number | 171228-49-2 | |
| SMILES | [H][C@@](C)(O)[C@]([H])(CC)N1N=CN(C1=O)C1=CC=C(C=C1)N1CCN(CC1)C1=CC=C(OC[C@]2([H])CO[C@](CN3C=NC=N3)(C2)C2=C(F)C=C(F)C=C2)C=C1 | |
| External Links | ||
| DRUGBANK | DB01263 | |
| T3DB | T3D3035 | |
| PubChem Compound | 468595 | |
| PDR | 369 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.5 | - | 5.5 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 4.0 | h | 3-5 | h | DRUGBANK | |
| Metabolic | 17.0 | % | 17 | % | Urinary excretion; Faeces excretion; | DRUGBANK |
| Clearance | 32.0 | L/h | 32.0 | L/h | DRUGBANK | Clearance | 51.0 | L/h | 51.0 | L/h | fasting; | DRUGBANK | Clearance | 21.0 | L/h | 21.0 | L/h | low fat meal; | DRUGBANK | Clearance | 14.0 | L/h | 14.0 | L/h | high-fat meal; | DRUGBANK | Clearance | 91.0 | L/h | 91.0 | L/h | fasting; | DRUGBANK | Clearance | 43.0 | L/h | 43.0 | L/h | liquid nutritional supplement; | DRUGBANK | Clearance | 0.26 | L/h/kg | 4.3 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1774.0 | L | 1774.0 | L | DRUGBANK | Volume of Distribution | 3.8 | L/kg | 3.8 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 35.0 | h | 35(20-66) | h | DRUGBANK | Half-life | 10.6 | h | 10.6 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 17.0 | % | 17 | % | Urinary excretion; Faeces excretion; | DRUGBANK |
| Protein Binding | 98.0 | % | >98 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 24.0 | mg/kg/day | 24 | mg/kg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for infants | 24.0 | mg/kg/day | 24 | mg/kg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for children | 24.0 | mg/kg/day | 24 | mg/kg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for children | 800.0 | mg/day | 800 | mg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for children | 600.0 | mg/day | 600 | mg/day | Tablet,PO，oral | Noxafil | posaconazole | PDR |
| Max dose for children | 24.0 | mg/kg/day | 24 | mg/kg/day | intravenous injection, IV | Noxafil | posaconazole | PDR |
| Max dose for adolescents | 800.0 | mg/day | 800 | mg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for adolescents | 600.0 | mg/day | 600 | mg/day | Tablet,PO，oral | Noxafil | posaconazole | PDR |
| Max dose for adolescents | 600.0 | mg/day | 600 | mg/day | intravenous injection, IV | Noxafil | posaconazole | PDR |
| Max dose for adults | 800.0 | mg/day | 800 | mg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for adults | 600.0 | mg/day | 600 | mg/day | Tablet,PO，oral | Noxafil | posaconazole | PDR |
| Max dose for adults | 600.0 | mg/day | 600 | mg/day | intravenous injection, IV | Noxafil | posaconazole | PDR |
| Max dose for geriatric | 800.0 | mg/day | 800 | mg/day | Liquid | Noxafil | posaconazole | PDR |
| Max dose for geriatric | 600.0 | mg/day | 600 | mg/day | Tablet,PO，oral | Noxafil | posaconazole | PDR |
| Max dose for geriatric | 600.0 | mg/day | 600 | mg/day | intravenous injection, IV | Noxafil | posaconazole | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1