Basic Information
| Drug ID | DDPD01261 |
|
| Drug Name | Sitagliptin | |
| Molecular Weight | 407.3136 | |
| Molecular Formula | C16H15F6N5O | |
| CAS Number | 486460-32-6 | |
| SMILES | N[C@@H](CC(=O)N1CCN2C(C1)=NN=C2C(F)(F)F)CC1=CC(F)=C(F)C=C1F | |
| External Links | ||
| DRUGBANK | DB01261 | |
| PubChem Compound | 4369359 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.5 | - | 1.5 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 87.0 | % | 87 | % | PO, oral; food; | food → ; | DRUGBANK |
| T Max | 2.0 | h | 2 | h | PO, oral; food; | food → ; | DRUGBANK |
| Metabolic | 79.0 | % | 79 | % | DRUGBANK | ||
| Clearance | 21.0 | L/h | 350.0 | ml/min | DRUGBANK | ||
| Clearance | 0.36 | L/h/kg | 6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Volume of Distribution | 198.0 | L | 198.0 | L | DRUGBANK | ||
| Volume of Distribution | 2.8 | L/kg | 2.8 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Half-life | 12.4 | h | ~12.4 | h | DRUGBANK | ||
| Half-life | 11.0 | h | ~11 | h | different study; | DRUGBANK | |
| Half-life | 12.0 | h | 12 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset | |
| Eliminate Route | 87.0 | % | 87 | % | Urinary excretion; | DRUGBANK | |
| Eliminate Route | 13.0 | % | 13 | % | Faeces excretion; | DRUGBANK | |
| Eliminate Route | 79.0 | % | ~79 | % | Urinary excretion; Unchanged drug; | DRUGBANK | |
| Protein Binding | 38.0 | % | 38 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1