Basic Information
| Drug ID | DDPD01249 |
|
| Drug Name | Iodixanol | |
| Molecular Weight | 1550.1819 | |
| Molecular Formula | C35H44I6N6O15 | |
| CAS Number | 92339-11-2 | |
| SMILES | CC(=O)N(CC(O)CN(C(C)=O)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I | |
| External Links | ||
| DRUGBANK | DB01249 | |
| PubChem Compound | 3724 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 0.5 | - | 0.5 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 0.0864 | L/h/kg | 1.44 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.26 | L/kg | 0.26 | L/kg | DRUGBANK | Volume of Distribution | 0.20 | L/kg | 0.2 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.1 | h | 2.1 | h | DRUGBANK | Half-life | 23.0 | h | 23 | h | severe renal function; | DRUGBANK | Half-life | 2.1 | h | 2.1 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 97.0 | % | ~97 | % | Urinary excretion; adults; Unchanged drug; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1