Basic Information
| Drug ID | DDPD01241 |
|
| Drug Name | Gemfibrozil | |
| Molecular Weight | 250.3334 | |
| Molecular Formula | C15H22O3 | |
| CAS Number | 25812-30-0 | |
| SMILES | CC1=CC(OCCCC(C)(C)C(O)=O)=C(C)C=C1 | |
| External Links | ||
| DRUGBANK | DB01241 | |
| T3DB | T3D4809 | |
| PubChem Compound | 3463 | |
| PDR | 983 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.387 | - | 4.387 | - | ChemSpider |
| Boiling Point | 158.5 | ℃ | 158.5 | ℃ | PhysProp |
| Melting Point | 59.5 | ℃ | 58-61 | ℃ | FDA Label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Bioavailability | 98.0 | % | 98±1 | % | PO, oral; | The Pharmacological Basis of Therapeutics | |
| C Max | 46000.0 | ng/ml | 46±16 | ug/ml | PO, oral; normal,healthy; | DRUGBANK | |
| C Max | 13800.0 | ng/ml | 13.8±11.1 | ug/ml | PO, oral; | DRUGBANK | |
| C Max | 23000.0 | ng/ml | 23.0±10.3 | ug/ml | PO, oral; hepatopathy，LD; | DRUGBANK | |
| C Max | 20000.0 | ng/ml | 15-25 | mcg/ml | PO, oral; | The Pharmacological Basis of Therapeutics | |
| T Max | 2.2 | h | 2.2±1.1 | h | PO, oral; normal,healthy; | DRUGBANK | |
| T Max | 2.3 | h | 2.3±1.0 | h | PO, oral; | DRUGBANK | |
| T Max | 2.6 | h | 2.6±1.7 | h | PO, oral; hepatopathy，LD; | DRUGBANK | |
| T Max | 1.5 | h | 1-2 | h | PO, oral; | The Pharmacological Basis of Therapeutics | |
| Clearance | 6.0 | L/h | 6.0 | L/h | DRUGBANK | ||
| Clearance | 0.10 | L/h/kg | 1.7±0.4 | ml/min/kg | Hepatic cirrhosis, cirr → ;RD, renal impairment, Renal disease，including uremia → ; | The Pharmacological Basis of Therapeutics | |
| Volume of Distribution | 0.80 | L/kg | 0.8 | L/kg | DRUGBANK | ||
| Volume of Distribution | 0.14 | L/kg | 0.14±0.03 | L/kg | The Pharmacological Basis of Therapeutics | ||
| Half-life | 1.5 | h | 1.5 | h | elimination half-life; | DRUGBANK | |
| Half-life | 2.4 | h | 2.4 | h | patients; | DRUGBANK | |
| Half-life | 2.1 | h | 2.1 | h | RD, renal impairment, Renal disease，including uremia; patients; | DRUGBANK | |
| Half-life | 1.1 | h | 1.1±0.2 | h | RD, renal impairment, Renal disease，including uremia → ; | The Pharmacological Basis of Therapeutics | |
| Toxicity LD50 | 2218.0 | mg/kg | 2218.0 | mg/kg | PO, oral; mouse; | DRUGBANK | |
| Toxicity LD50 | 1414.0 | mg/kg | 1414.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | |
| Toxicity LD50 | 445.0 | mg/kg | 445.0 | mg/kg | Intraperitoneal, IP; Rattus, Rat; | DRUGBANK | |
| Toxicity LD50 | 3162.0 | mg/kg | 3162.0 | mg/kg | PO, oral; mouse; | T3DB | |
| Eliminate Route | 70.0 | % | ~70 | % | Urinary excretion; | DRUGBANK | |
| Eliminate Route | 6.0 | % | ~6 | % | Faeces excretion; | DRUGBANK | |
| Eliminate Route | 1.0 | % | <1 | % | Urinary excretion; Unchanged drug; | The Pharmacological Basis of Therapeutics | |
| Protein Binding | 99.0 | % | 99 | % | DRUGBANK | ||
| Protein Binding | 98.6 | % | 98.6 | % | DRUGBANK | ||
| Protein Binding | 0 | % | ~0 | % | DRUGBANK | ||
| Protein Binding | 0.80 | % | 0.8 | % | serum albumin; | DRUGBANK | |
| Protein Binding | 97.0 | % | 97 | % | The Pharmacological Basis of Therapeutics |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 1200.0 | mg/day | 1200 | mg/day | PO, oral | Lopid | gemfibrozil | PDR |
| Max dose for adults | 1600.0 | mg/day | 1600 | mg/day | PO, oral | Lopid | gemfibrozil | PDR |
| Max dose for elderly | 1200.0 | mg/day | 1200 | mg/day | PO, oral | Lopid | gemfibrozil | PDR |
| Max dose for elderly | 1600.0 | mg/day | 1600 | mg/day | PO, oral | Lopid | gemfibrozil | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1