Basic Information
| Drug ID | DDPD01222 |
|
| Drug Name | Budesonide | |
| Molecular Weight | 430.5339 | |
| Molecular Formula | C25H34O6 | |
| CAS Number | 51333-22-3 | |
| SMILES | [H][C@@]12C[C@H]3OC(CCC)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@]12C | |
| External Links | ||
| DRUGBANK | DB01222 | |
| PubChem Compound | 5281004 | |
| PDR | 1716 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.914 | - | 1.914 | - | ChemSpider |
| Boiling Point | 599.7 | ℃ | 599.7 | ℃ | ChemSpider |
| Melting Point | 226.0 | ℃ | 226 | ℃ | PhysProp |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 7.3 | ng.h/ml | 7.33 | ng.h/ml | PO, oral; | DRUGBANK | AUC | 16.4 | ng.h/ml | 16.43±10.52 | ng.h/ml | Tablet, PO, oral; extended release formulation; different study; | DRUGBANK | AUC | 4.3 | ng.h/ml | 4.31 | ng.h/ml | Rectal Administration; | DRUGBANK |
| Bioavailability | 15.0 | % | 9-21 | % | Capsule, PO, Oral; extended release formulation; | DRUGBANK | Bioavailability | 39.0 | % | 39 | % | inhalation, IH; | DRUGBANK | Bioavailability | 6.0 | % | 6 | % | inhalation, IH; | DRUGBANK |
| C Max | 1.5 | ng/ml | 1.50±0.79 | ng/ml | PO, oral; | DRUGBANK | C Max | 0.47 | ng/ml | 0.6-1.6 | nmol/L | inhalation, IH; | DRUGBANK | C Max | 1.1 | ng/ml | 2.6 | nmol/L | inhalation, IH; | DRUGBANK | C Max | 1.4 | ng/ml | 1.35±0.96 | ng/ml | Tablet, PO, oral; extended release formulation; different study; | DRUGBANK |
| T Max | 5.0 | h | 2-8 | h | PO, oral; | DRUGBANK | T Max | 7.3 | h | 4.3-10.3 | h | Tablet, PO, oral; high-fat meal; | DRUGBANK | T Max | 0.17 | h | 10 | min | inhalation, IH; | DRUGBANK | T Max | 0.33 | h | 20 | min | inhalation, IH; | DRUGBANK | T Max | 13.3 | h | 13.3±5.9 | h | Tablet, PO, oral; extended release formulation; different study; | DRUGBANK |
| Metabolic | 85.0 | % | 80-90 | % | DRUGBANK | |
| Clearance | 108.0 | L/h | 1.8 | L/min | Plasma clearance; | DRUGBANK | Clearance | 84.0 | L/h | 1.4 | L/min | DRUGBANK | Clearance | 60.0 | L/h | 1.0 | L/min | DRUGBANK | Clearance | 30.0 | L/h | 0.5 | L/min | asthma; Children; | DRUGBANK | Clearance | 1.2 | L/h/kg | 20 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 3.1 | L/kg | 2.2-3.9 | L/kg | DRUGBANK | Volume of Distribution | 3.9 | L/kg | 3.9 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 2.8 | h | 2-3.6 | h | elimination half-life; | DRUGBANK | Half-life | 2.3 | h | 2.3 | h | elimination half-life; asthma; Children; | DRUGBANK | Half-life | 2.8 | h | 2.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity Lethal Dose | 200.0 | mg | 200.0 | mg | PO, oral; female mouse; | DRUGBANK | Toxicity Lethal Dose | 400.0 | mg | 400.0 | mg | PO, oral; male mouse; | DRUGBANK |
| Eliminate Route | 60.0 | % | ~60 | % | Urinary excretion; | DRUGBANK |
| Protein Binding | 87.5 | % | 85-90 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 1.0 | mg/day | 1 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for children | 0.256 | mg/day | 256 | mcg/day | intranasal | Entocort EC | budesonide | PDR |
| Max dose for children | 0.72 | mg/day | 720 | mcg/day | inhalation, IH | Entocort EC | budesonide | PDR |
| Max dose for children | 4.0 | mg/day | 4 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for children | 12.0 | mg/day | 12 | mg/day | Capsule, PO, Oral | Entocort EC | budesonide | PDR |
| Max dose for children | 0.128 | mg/day | 128 | mcg/day | intranasal | Entocort EC | budesonide | PDR |
| Max dose for children | 0.72 | mg/day | 720 | mcg/day | inhalation, IH | Entocort EC | budesonide | PDR |
| Max dose for children | 1.0 | mg/day | 1 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for children | 4.0 | mg/day | 4 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for children | 12.0 | mg/day | 12 | mg/day | Capsule, PO, Oral | Entocort EC | budesonide | PDR |
| Max dose for children | 1.0 | mg/day | 1 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for children | 4.0 | mg/day | 4 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for adolescents | 0.256 | mg/day | 256 | mcg/day | intranasal | Entocort EC | budesonide | PDR |
| Max dose for adolescents | 0.72 | mg/day | 720 | mcg/day | inhalation, IH | Entocort EC | budesonide | PDR |
| Max dose for adolescents | 4.0 | mg/day | 4 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for adolescents | 12.0 | mg/day | 12 | mg/day | Capsule, PO, Oral | Entocort EC | budesonide | PDR |
| Max dose for adults | 8.0 | mg/day | 8 | mg/day | Liquid | Entocort EC | budesonide | PDR |
| Max dose for geriatric | 8.0 | mg/day | 8 | mg/day | Liquid | Entocort EC | budesonide | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1