Basic Information
| Drug ID | DDPD01219 |
|
| Drug Name | Dantrolene | |
| Molecular Weight | 314.257 | |
| Molecular Formula | C14H10N4O5 | |
| CAS Number | 7261-97-4 | |
| SMILES | [O-][N+](=O)C1=CC=C(C=C1)C1=CC=C(O1)\C=N\N1CC(=O)NC1=O | |
| External Links | ||
| DRUGBANK | DB01219 | |
| PubChem Compound | 6914273 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.7 | - | 1.7 | - | JANSEN,ACA ET AL. (1991) |
| Melting Point | 279.5 | ℃ | 279-280 | ℃ | Davis, C.S. and Snyder, H.R. Jr.; US. Patent 3,415,821; December 10, 1968; assigned to The Norwich Pharmacal Company. |
| Water Solubility | 146.0 | mg/L | 146 | mg/L | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 70.0 | % | 70 | % | DRUGBANK | |
| Clearance | 0.0258 | L/h/kg | 0.43 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.37 | L/kg | 0.37 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 6.0 | h | 4-8 | h | elimination half-life; intravenous injection, IV; | DRUGBANK | Half-life | 8.7 | h | 8.7 | h | PO, oral; | DRUGBANK | Half-life | 10.0 | h | 10 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 7400.0 | mg/kg | 7400.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1