Basic Information
| Drug ID | DDPD01175 |
|
| Drug Name | Escitalopram | |
| Molecular Weight | 324.3919 | |
| Molecular Formula | C20H21FN2O | |
| CAS Number | 128196-01-0 | |
| SMILES | CN(C)CCC[C@]1(OCC2=C1C=CC(=C2)C#N)C1=CC=C(F)C=C1 | |
| External Links | ||
| DRUGBANK | DB01175 | |
| T3DB | T3D3007 | |
| PubChem Compound | 146570 | |
| PDR | 2214 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.34 | - | 1.34 | - | DPD Label |
| Melting Point | 147.0 | ℃ | 147-152 | ℃ | DPD Label |
| pKa | 9.5 | - | 9.5 | - | DPD Label |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | ~100 | % | PO, oral; | DRUGBANK |
| AUC | 360.0 | ng.h/ml | 360.0 | ng.h/ml | PO, oral; patients; | DRUGBANK | AUC | 1080.0 | ng.h/ml | 1080.0 | ng.h/ml | PO, oral; patients; | DRUGBANK |
| Bioavailability | 80.0 | % | ~80 | % | PO, oral; | DRUGBANK |
| C Max | 21.0 | ng/ml | 21 | ng/ml | PO, oral; patients; | DRUGBANK | C Max | 63.0 | ng/ml | 63 | ng/ml | PO, oral; patients; | DRUGBANK |
| T Max | 4.5 | h | 4-5 | h | PO, oral; | DRUGBANK |
| Clearance | 36.0 | L/h | 600.0 | ml/min | Plasma clearance; PO, oral; | DRUGBANK |
| Volume of Distribution | 19.0 | L/kg | ~12-26 | L/kg | Apparent volume of distribution; | DRUGBANK |
| Half-life | 29.5 | h | 27-32 | h | elimination half-life; | DRUGBANK | Half-life | 44.3 | h | 40.5-48 | h | adults; | DRUGBANK | Half-life | 59.0 | h | 54-64 | h | hepatopathy，LD; | DRUGBANK | Half-life | 54.0 | h | ~54 | h | elimination half-life; at steady state; | DRUGBANK |
| Eliminate Route | 8.0 | % | ~8 | % | Urinary excretion; PO, oral; | DRUGBANK | Eliminate Route | 8.0 | % | ~8 | % | Urinary excretion; PO, oral; Unchanged drug; | DRUGBANK |
| Protein Binding | 55.5 | % | ~55-56 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 20.0 | mg/day | 20 | mg/day | PO, oral | Lexapro | escitalopram oxalate | PDR |
| Max dose for children | 20.0 | mg/day | 20 | mg/day | PO, oral | Lexapro | escitalopram oxalate | PDR |
| Max dose for adolescents | 20.0 | mg/day | 20 | mg/day | PO, oral | Lexapro | escitalopram oxalate | PDR |
| Max dose for adults | 20.0 | mg/day | 20 | mg/day | PO, oral | Lexapro | escitalopram oxalate | PDR |
| Max dose for geriatric | 10.0 | mg/day | 10 | mg/day | PO, oral | Lexapro | escitalopram oxalate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1