Basic Information
| Drug ID | DDPD01135 |
|
| Drug Name | Doxacurium | |
| Molecular Weight | 1035.2223 | |
| Molecular Formula | C56H78N2O16 | |
| CAS Number | 106791-39-3 | |
| SMILES | COC1=CC(CC2C3=C(OC)C(OC)=C(OC)C=C3CC[N+]2(C)CCCOC(=O)CCC(=O)OCCC[N+]2(C)CCC3=CC(OC)=C(OC)C(OC)=C3C2CC2=CC(OC)=C(OC)C(OC)=C2)=CC(OC)=C1OC | |
| External Links | ||
| DRUGBANK | DB01135 | |
| PubChem Compound | 5284551 | |
Experimental Physicochemical Property
Not Available
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 0.16 | L/h/kg | 2.66 | ml/min/kg | normal,healthy; young; patients; | DRUGBANK | Clearance | 0.0738 | L/h/kg | 1.23 | ml/min/kg | renal transplant; patients; | DRUGBANK | Clearance | 0.14 | L/h/kg | 2.3 | ml/min/kg | liver transplant; patients; | DRUGBANK | Clearance | 0.11 | L/h/kg | 1.75±0.16 | ml/min/kg | Geriatric; | DRUGBANK | Clearance | 0.15 | L/h/kg | 2.54±0.24 | ml/min/kg | patients; young; | DRUGBANK | Clearance | 0.16 | L/h/kg | 2.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 0.27 | L/kg | 0.11-0.43 | L/kg | normal,healthy; patients; young; | DRUGBANK | Volume of Distribution | 0.36 | L/kg | 0.17-0.55 | L/kg | renal transplant; patients; | DRUGBANK | Volume of Distribution | 0.26 | L/kg | 0.17-0.35 | L/kg | liver transplant; patients; | DRUGBANK | Volume of Distribution | 0.22 | L/kg | 0.22 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 1.7 | h | 99 | min | normal,healthy; adults; | DRUGBANK | Half-life | 1.7 | h | 1.7 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 30.0 | % | ~30 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1