Basic Information
| Drug ID | DDPD01127 |
|
| Drug Name | Econazole | |
| Molecular Weight | 381.684 | |
| Molecular Formula | C18H15Cl3N2O | |
| CAS Number | 27220-47-9 | |
| SMILES | ClC1=CC=C(COC(CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1 | |
| External Links | ||
| DRUGBANK | DB01127 | |
| T3DB | T3D2992 | |
| PubChem Compound | 3198 | |
| PDR | 3386 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 5.5 | - | 5.5 | - | DRUGBANK |
| Melting Point | 162.0 | ℃ | 162 | ℃ | Godefroi, E.F. and Heeres, J.; U.S. Patent 3,717,655; February 20,1973; assigned to Jansen Pharmaceutica NV, Belgium. |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Toxicity LD50 | 462.0 | mg/kg | 462.0 | mg/kg | PO, oral; mouse; | DRUGBANK | Toxicity LD50 | 668.0 | mg/kg | 668.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 272.0 | mg/kg | 272.0 | mg/kg | PO, oral; guinea pigs; | DRUGBANK | Toxicity LD50 | 160.0 | mg/kg | >160 | mg/kg | PO, oral; dog; | DRUGBANK | Toxicity LD50 | 462.0 | mg/kg | 462.0 | mg/kg | PO, oral; mouse; | T3DB | Toxicity LD50 | 462.0 | mg/kg | 462.0 | mg/kg | PO, oral; Rattus, Rat; | T3DB | Toxicity LD50 | 668.0 | mg/kg | 668.0 | mg/kg | PO, oral; guinea pigs; | T3DB | Toxicity LD50 | 160.0 | mg/kg | >160 | mg/kg | PO, oral; dog; | T3DB |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1