Basic Information
| Drug ID | DDPD01109 |
|
| Drug Name | Heparin | |
| Molecular Weight | N.A. | |
| Molecular Formula | N.A. | |
| CAS Number | 9005-49-6 | |
| SMILES | CC(=O)NC1C(C(C(OC1O)COS(=O)(=O)O)OC2C(C(C(C(O2)C(=O)O)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O)NS(=O)(=O)O)O)OS(=O)(=O)O)O | |
| External Links | ||
| DRUGBANK | DB01109 | |
| T3DB | T3D2566 | |
| PubChem Compound | 772 | |
| PDR | 1263 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -13.2 | - | -13.2 | - | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 0 | % | 0 | % | PO, oral; | DRUGBANK |
| C Max | 70.0 | ng/ml | 70±39 | ng/ml | The Pharmacological Basis of Therapeutics | |
| T Max | 3.0 | h | 3.0 | h | The Pharmacological Basis of Therapeutics | |
| Clearance | 0.0258 | L/h/kg | 0.43 | ml/kg/min | adults; | DRUGBANK | Clearance | 0.0894 | L/h/kg | 1.49 | ml/kg/min | Preg, pregnant; | DRUGBANK |
| Volume of Distribution | 3.3 | L/h | 40-70 | mL/min | DRUGBANK | Volume of Distribution | 0.0580 | L/kg | 0.058±0.11 | L/kg | Apparent volume of distribution; | The Pharmacological Basis of Therapeutics |
| Half-life | 1.5 | h | 1.5 | h | DRUGBANK | |
| Toxicity LD50 | 5000.0 | mg/kg | >5000 | mg/kg | mouse; | DRUGBANK |
| Eliminate Route | 0 | % | ~0 | % | Urinary excretion; Unchanged drug; | The Pharmacological Basis of Therapeutics |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for neonates | 0.4 | units/ml | 0.4 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for neonates | 0.7 | units/ml | 0.7 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for infants | 0.4 | units/ml | 0.4 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for infants | 0.7 | units/ml | 0.7 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for children | 0.4 | units/ml | 0.4 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for children | 0.7 | units/ml | 0.7 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for adolescents | 0.4 | units/ml | 0.4 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for adolescents | 0.7 | units/ml | 0.7 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for geriatric | 0.4 | units/ml | 0.4 | units/ml | Heparin Sodium Injection | heparin sodium | PDR | |
| Max dose for geriatric | 0.7 | units/ml | 0.7 | units/ml | Heparin Sodium Injection | heparin sodium | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1