| Drug ID | DDPD01010 |
|
| Drug Name | Edrophonium | |
| Molecular Weight | 166.2401 | |
| Molecular Formula | C10H16NO | |
| CAS Number | 312-48-1 | |
| SMILES | CC[N+](C)(C)C1=CC(O)=CC=C1 | |
| External Links | ||
| DRUGBANK | DB01010 | |
| PubChem Compound | 3202 | |
| PDR | 1738 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -2.95 | - | -2.95 | - | DRUGBANK |
| Melting Point | 162.5 | ℃ | 162-163 | ℃ | Terrell, R.C.; U.S. Patents 3,469,011; September 23, 1969 and 3,527,813; September 8, 1970; both assigned to Air Reduction Company, Incorporated. |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 0.41 | L/h/kg | 6.8±2 | ml/kg/min | adults; | DRUGBANK | Clearance | 0.38 | L/h/kg | 6.4±3.9 | ml/kg/min | Children; | DRUGBANK | Clearance | 0.17 | L/h/kg | 2.9±1.9 | ml/kg/min | Elderly; | DRUGBANK | Clearance | 0.58 | L/h/kg | 9.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1.6 | L/kg | 1.6±0.4 | L/kg | adults; | DRUGBANK | Volume of Distribution | 2.2 | L/kg | 2.2±1.5 | L/kg | Children; | DRUGBANK | Volume of Distribution | 1.8 | L/kg | 1.8±1.2 | L/kg | Elderly; | DRUGBANK | Volume of Distribution | 1.1 | L/kg | 1.1 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.16 | h | 7-12 | min | distribution half-life; | DRUGBANK | Half-life | 1.2 | h | 33-110 | min | elimination half-life; | DRUGBANK | Half-life | 1.8 | h | 1.8 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 67.0 | % | 67 | % | Urinary excretion; | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 0.5 | mg | 0.5 | mg | intravenous injection, IV | Enlon | edrophonium chloride | PDR |
| Max dose for children | 10.0 | mg | 10 | mg | intravenous injection, IV | Enlon | edrophonium chloride | PDR |
| Max dose for children | 5.0 | mg | 5 | mg | intravenous injection, IV | Enlon | edrophonium chloride | PDR |
| Max dose for adolescents | 10.0 | mg | 10 | mg | intravenous injection, IV | Enlon | edrophonium chloride | PDR |
| Max dose for adults | 10.0 | mg/dose | 10 | mg/dose | intravenous injection, IV | Enlon | edrophonium chloride | PDR |
| Max dose for geriatric | 10.0 | mg/dose | 10 | mg/dose | intravenous injection, IV | Enlon | edrophonium chloride | PDR |