Basic Information
| Drug ID | DDPD00975 |
|
| Drug Name | Dipyridamole | |
| Molecular Weight | 504.6256 | |
| Molecular Formula | C24H40N8O4 | |
| CAS Number | 58-32-2 | |
| SMILES | OCCN(CCO)C1=NC2=C(N=C(N=C2N2CCCCC2)N(CCO)CCO)C(=N1)N1CCCCC1 | |
| External Links | ||
| DRUGBANK | DB00975 | |
| PubChem Compound | 3108 | |
| PDR | 1141 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.5 | - | 1.5 | - | DRUGBANK |
| Melting Point | 163.0 | ℃ | 163 | ℃ | PhysProp |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 70.0 | % | 70 | % | DRUGBANK | |
| Clearance | 0.17 | L/h/kg | 2.3-3.5 | ml/min/kg | DRUGBANK | Clearance | 0.12 | L/h/kg | 2 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 1.8 | L/kg | 1-2.5 | L/kg | DRUGBANK | Volume of Distribution | 0.82 | L/kg | 0.82 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 0.67 | h | 40 | min | DRUGBANK | Half-life | 13.0 | h | 13 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 6000.0 | mg/kg | >6000 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 400.0 | mg/kg | ~400 | mg/kg | PO, oral; dog; | DRUGBANK | Toxicity LD50 | 8400.0 | mg/kg | 8.4 | g/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Protein Binding | 99.0 | % | 99 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adolescents | 400.0 | mg/day | 400 | mg/day | PO, oral | Dipyridamole | dipyridamole | PDR |
| Max dose for adults | 400.0 | mg/day | 400 | mg/day | PO, oral | Dipyridamole | dipyridamole | PDR |
| Max dose for elderly | 400.0 | mg/day | 400 | mg/day | PO, oral | Dipyridamole | dipyridamole | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1