Basic Information
| Drug ID | DDPD00966 |
|
| Drug Name | Telmisartan | |
| Molecular Weight | 514.6169 | |
| Molecular Formula | C33H30N4O2 | |
| CAS Number | 144701-48-4 | |
| SMILES | CCCC1=NC2=C(C=C(C=C2C)C2=NC3=CC=CC=C3N2C)N1CC1=CC=C(C=C1)C1=CC=CC=C1C(O)=O | |
| External Links | ||
| DRUGBANK | DB00966 | |
| PubChem Compound | 65999 | |
| PDR | 1320 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Caco-2 Permeability | -4.82 | - | -4.82 | - | ADME Research, USCD |
| Log P | 7.7 | - | 7.7 | - | DRUGBANK |
| Melting Point | 262.0 | ℃ | 261-263 | ℃ | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| Clearance | 48.0 | L/h | >800 | ml/min | DRUGBANK | Clearance | 0.50 | L/h/kg | 8.4 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 500.0 | L | 500.0 | L | DRUGBANK | Volume of Distribution | 5.3 | L/kg | 5.3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 24.0 | h | ~24 | h | elimination half-life; | DRUGBANK | Half-life | 20.0 | h | 20 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 175.0 | mg/kg | 150-200 | mg/kg | intravenous injection, IV; Male, men; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 225.0 | mg/kg | 200-250 | mg/kg | intravenous injection, IV; Female, women; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 97.0 | % | >97 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 97.0 | % | >97 | % | Faeces excretion; PO, oral; intravenous injection, IV; Unchanged drug; | DRUGBANK |
| Protein Binding | 99.5 | % | 99.5 | % | plasma proteins; | dose → ; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 80.0 | mg/day | 80 | mg/day | PO, oral | Micardis | telmisartan | PDR |
| Max dose for elderly | 80.0 | mg/day | 80 | mg/day | PO, oral | Micardis | telmisartan | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1