Basic Information
| Drug ID | DDPD00960 |
|
| Drug Name | Pindolol | |
| Molecular Weight | 248.3208 | |
| Molecular Formula | C14H20N2O2 | |
| CAS Number | 13523-86-9 | |
| SMILES | CC(C)NCC(O)COC1=CC=CC2=C1C=CN2 | |
| External Links | ||
| DRUGBANK | DB00960 | |
| PubChem Compound | 4828 | |
| PDR | 3350 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Caco-2 Permeability | -4.78 | - | -4.78 | - | ADME Research, USCD |
| Log P | 1.75 | - | 1.75 | - | SANGSTER (1994) |
| Melting Point | 171.0 | ℃ | 171 | ℃ | PhysProp |
| Water Solubility | 7880.0 | mg/L | 7880 | mg/L | DRUGBANK |
| pKa | 9.25 | - | 9.25 | - | SANGSTER (1994) |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 95.0 | % | >95 | % | DRUGBANK | |
| Metabolic | 62.5 | % | 60-65 | % | DRUGBANK | Metabolic | 37.5 | % | 35-40 | % | Urinary excretion; | DRUGBANK |
| Clearance | 10.5 | L/h | 50-300 | ml/min | Hepatitis, Hep; | DRUGBANK | Clearance | 0.46 | L/h/kg | 7.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 2.0 | L/kg | 2.0 | L/kg | DRUGBANK | Volume of Distribution | 1.2 | L/kg | 1.2 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 3.5 | h | 3-4 | h | DRUGBANK | Half-life | 2.2 | h | 2.2 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 263.0 | mg/kg | 263.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 7.5 | % | ~6-9 | % | Faeces excretion; intravenous injection, IV; | DRUGBANK | Eliminate Route | 37.5 | % | 35-40 | % | Urinary excretion; human, homo sapiens; Unchanged drug; | DRUGBANK |
| Protein Binding | 40.0 | % | 40 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 60.0 | mg/day | 60 | mg/day | PO, oral | Pindolol | pindolol | PDR |
| Max dose for adults | 40.0 | mg/day | 40 | mg/day | PO, oral | Pindolol | pindolol | PDR |
| Max dose for elderly | 60.0 | mg/day | 60 | mg/day | PO, oral | Pindolol | pindolol | PDR |
| Max dose for elderly | 40.0 | mg/day | 40 | mg/day | PO, oral | Pindolol | pindolol | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1