Basic Information
| Drug ID | DDPD00952 |
|
| Drug Name | Naratriptan | |
| Molecular Weight | 335.464 | |
| Molecular Formula | C17H25N3O2S | |
| CAS Number | 121679-13-8 | |
| SMILES | CNS(=O)(=O)CCC1=CC2=C(NC=C2C2CCN(C)CC2)C=C1 | |
| External Links | ||
| DRUGBANK | DB00952 | |
| T3DB | T3D2939 | |
| PubChem Compound | 4440 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.6 | - | 1.6 | - | DRUGBANK |
| Melting Point | 246.0 | ℃ | 246 | ℃ | DRUGBANK |
| Water Solubility | 35000.0 | mg/L | 35 | mg/ml | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 74.0 | % | 74 | % | PO, oral; | DRUGBANK |
| T Max | 3.5 | h | 2-5 | h | PO, oral; | DRUGBANK |
| Clearance | 0.40 | L/h/kg | 6.6 | ml/min/kg | DRUGBANK | Clearance | 0.40 | L/h/kg | 6.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 170.0 | L | 170.0 | L | DRUGBANK | Volume of Distribution | 2.4 | L/kg | 2.4 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 6.5 | h | 5-8 | h | DRUGBANK | Half-life | 6.6 | h | 6.6 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 29.5 | % | 28-31 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1