Basic Information
| Drug ID | DDPD00950 |
|
| Drug Name | Fexofenadine | |
| Molecular Weight | 501.6564 | |
| Molecular Formula | C32H39NO4 | |
| CAS Number | 83799-24-0 | |
| SMILES | CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB00950 | |
| T3DB | T3D2938 | |
| PubChem Compound | 3348 | |
| PDR | 1459 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Melting Point | 142.5 | ℃ | 142.5 | ℃ | PhysProp |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Factor | Reference |
|---|---|---|---|---|---|---|---|
| AUC | 1367.0 | ng.h/ml | 1367.0 | ng.h/ml | Oral multiple dose; | DRUGBANK | |
| Bioavailability | 33.0 | % | 33 | % | DRUGBANK | ||
| C Max | 299.0 | ng/ml | 299 | ng/ml | Oral multiple dose; | DRUGBANK | |
| C Max | 286.0 | ng/ml | 286±143 | ng/ml | PO, oral; | The Pharmacological Basis of Therapeutics | |
| T Max | 2.0 | h | 1-3 | h | DRUGBANK | ||
| T Max | 1.3 | h | 1.3±0.6 | h | PO, oral; | The Pharmacological Basis of Therapeutics | |
| Metabolic | 5.0 | % | 5 | % | Liver metabolism; | DRUGBANK | |
| Metabolic | 3.6 | % | 3.6 | % | DRUGBANK | ||
| Metabolic | 1.5 | % | 1.5 | % | DRUGBANK | ||
| Clearance | 50.6 | L/h | 50.6 | L/h | PO, oral; | DRUGBANK | |
| Clearance | 4.2 | L/h | 4.23 | L/h | Renal clearance; | DRUGBANK | |
| Clearance | 0.56 | L/h/kg | 9.4±4.2 | ml/min/kg | apparent clearance; PO, oral; | The Pharmacological Basis of Therapeutics | |
| Volume of Distribution | 5.6 | L/kg | ~5.4-5.8 | L/kg | DRUGBANK | ||
| Half-life | 13.0 | h | ~11-15 | h | elimination half-life; | DRUGBANK | |
| Half-life | 14.0 | h | 14±6 | h | PO, oral; | mild renal function ↑ ;chronic liver disease → ; | The Pharmacological Basis of Therapeutics |
| Eliminate Route | 80.0 | % | ~80 | % | Faeces excretion; | DRUGBANK | |
| Eliminate Route | 11.0 | % | 11 | % | Urinary excretion; | DRUGBANK | |
| Eliminate Route | 12.0 | % | 12 | % | Urinary excretion; adults; Male, men; normal,healthy; human, homo sapiens; Unchanged drug; | The Pharmacological Basis of Therapeutics | |
| Protein Binding | 65.0 | % | 60-70 | % | plasma proteins; | DRUGBANK | |
| Protein Binding | 62.0 | % | 56-68 | % | plasma proteins; RD, renal impairment, Renal disease，including uremia; | DRUGBANK | |
| Protein Binding | 65.5 | % | 56-75 | % | plasma proteins; hepatopathy，LD; | DRUGBANK | |
| Protein Binding | 65.0 | % | 60-70 | % | adults; Male, men; normal,healthy; human, homo sapiens; | The Pharmacological Basis of Therapeutics |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Frequency | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|---|
| Max dose for infants | 30.0 | mg/day | 30 | mg/day | PO, oral | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR | |
| Max dose for children | 180.0 | mg/day | 180 | mg/day | PO, oral | qd | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for children | 120.0 | mg/day | 120 | mg/day | PO, oral | bid | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for children | 60.0 | mg/day | 60 | mg/day | PO, oral | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR | |
| Max dose for children | 30.0 | mg/day | 30 | mg/day | PO, oral | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR | |
| Max dose for adolescents | 180.0 | mg/day | 180 | mg/day | Tablet,PO，oral | qd | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for adolescents | 120.0 | mg/day | 120 | mg/day | Tablet,PO，oral | bid | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for adults | 180.0 | mg/day | 180 | mg/day | Tablet,PO，oral | qd | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for adults | 120.0 | mg/day | 120 | mg/day | Tablet,PO，oral | bid | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for geriatric | 180.0 | mg/day | 180 | mg/day | Tablet,PO，oral | qd | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
| Max dose for geriatric | 120.0 | mg/day | 120 | mg/day | Tablet,PO，oral | bid | Allegra Allergy Tablets | fexofenadine hydrochloride | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1