Basic Information
| Drug ID | DDPD00938 |
|
| Drug Name | Salmeterol | |
| Molecular Weight | 415.5656 | |
| Molecular Formula | C25H37NO4 | |
| CAS Number | 89365-50-4 | |
| SMILES | OCC1=C(O)C=CC(=C1)C(O)CNCCCCCCOCCCCC1=CC=CC=C1 | |
| External Links | ||
| DRUGBANK | DB00938 | |
| T3DB | T3D4734 | |
| PubChem Compound | 5152 | |
| PDR | 225 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.2 | - | 4.2 | - | Prentice, Jaffe, and Thomas, 2016 |
| Boiling Point | 603.0 | ℃ | 603 | ℃ | ChemSpider |
| Melting Point | 76.0 | ℃ | 75.5-76.5 | ℃ | ChemSpider |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| AUC | 0.16 | ng.h/ml | 156.041 | pg.h/ml | inhalation, IH; | DRUGBANK |
| C Max | 0.0479 | ng/ml | 47.897 | pg/ml | inhalation, IH; | DRUGBANK |
| T Max | 0.24 | h | 0.24 | h | inhalation, IH; | DRUGBANK |
| Clearance | 392.0 | L/h | 392.0 | L/h | Average clearance; asthma; patients; | DRUGBANK |
| Volume of Distribution | 177.0 | L | 177.0 | L | Total volume of distribution; asthma; patients; | DRUGBANK | Volume of Distribution | 3160.0 | L | 3160.0 | L | Total volume of distribution; asthma; patients; | DRUGBANK |
| Half-life | 5.5 | h | 5.5 | h | DRUGBANK | |
| Eliminate Route | 57.4 | % | 57.4 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 23.0 | % | 23 | % | Urinary excretion; | DRUGBANK | Eliminate Route | 5.0 | % | <5 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 96.0 | % | 96 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.1 | mg/day | 100 | mcg/day | inhalation, IH | Serevent Diskus | salmeterol xinafoate | PDR |
| Max dose for adolescents | 0.1 | mg/day | 100 | mcg/day | inhalation, IH | Serevent Diskus | salmeterol xinafoate | PDR |
| Max dose for adults | 0.1 | mg/day | 100 | mcg/day | inhalation, IH | Serevent Diskus | salmeterol xinafoate | PDR |
| Max dose for geriatric | 0.1 | mg/day | 100 | mcg/day | inhalation, IH | Serevent Diskus | salmeterol xinafoate | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1