Basic Information
| Drug ID | DDPD00911 |
|
| Drug Name | Tinidazole | |
| Molecular Weight | 247.272 | |
| Molecular Formula | C8H13N3O4S | |
| CAS Number | 19387-91-8 | |
| SMILES | CCS(=O)(=O)CCN1C(C)=NC=C1[N+]([O-])=O | |
| External Links | ||
| DRUGBANK | DB00911 | |
| PubChem Compound | 5479 | |
| PDR | 413 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | -0.35 | - | -0.35 | - | HANSCH,C ET AL. (1995) |
| Melting Point | 127.5 | ℃ | 127-128 | ℃ | PhysProp |
| Water Solubility | 19900.0 | mg/L | 19900 | mg/L | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Absorption | 100.0 | % | 100 | % | PO, oral; fasting; | DRUGBANK |
| AUC | 901600.0 | ng.h/ml | 901.6±126.5 | mcg.h/ml | PO, oral; food; | DRUGBANK |
| Clearance | 0.0360 | L/h/kg | 0.6 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 50.0 | L | 50.0 | L | DRUGBANK | Volume of Distribution | 0.59 | L/kg | 0.59 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 13.2 | h | 13.2±1.4 | h | elimination half-life; | DRUGBANK | Half-life | 13.0 | h | 12-14 | h | elimination half-life; | DRUGBANK | Half-life | 13.0 | h | 13 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 3600.0 | mg/kg | >3600 | mg/kg | PO, oral; mouse; | DRUGBANK | Toxicity LD50 | 2300.0 | mg/kg | >2300 | mg/kg | Intraperitoneal, IP; mouse; | DRUGBANK | Toxicity LD50 | 2000.0 | mg/kg | >2000 | mg/kg | PO, oral; Intraperitoneal, IP; Rattus, Rat; | DRUGBANK |
| Eliminate Route | 12.0 | % | ~12 | % | Faeces excretion; | DRUGBANK | Eliminate Route | 22.5 | % | ~20-25 | % | Urinary excretion; Unchanged drug; | DRUGBANK |
| Protein Binding | 12.0 | % | 12 | % | plasma proteins; | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 50.0 | mg/kg/dose | 50 | mg/kg/dose | PO, oral | Tindamax | tinidazole | PDR |
| Max dose for children | 2000.0 | mg/dose | 2 | g/dose | PO, oral | Tindamax | tinidazole | PDR |
| Max dose for adolescents | 50.0 | mg/kg/dose | 50 | mg/kg/dose | PO, oral | Tindamax | tinidazole | PDR |
| Max dose for adolescents | 2000.0 | mg/dose | 2 | g/dose | PO, oral | Tindamax | tinidazole | PDR |
| Max dose for adults | 2000.0 | mg/day | 2 | g/day | PO, oral | Tindamax | tinidazole | PDR |
| Max dose for geriatric | 2000.0 | mg/day | 2 | g/day | PO, oral | Tindamax | tinidazole | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1