| Drug ID | DDPD00910 |
|
| Drug Name | Paricalcitol | |
| Molecular Weight | 416.6365 | |
| Molecular Formula | C27H44O3 | |
| CAS Number | 131918-61-1 | |
| SMILES | [H][C@@]1(CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1C[C@@H](O)C[C@H](O)C1)[C@H](C)\C=C\[C@H](C)C(C)(C)O | |
| External Links | ||
| DRUGBANK | DB00910 | |
| PubChem Compound | 5281104 | |
| PDR | 37 | |
| Drugs.com | Drugs.com Drug Page | |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 4.5 | - | 4.5 | - | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Clearance | 1.5 | L/h | 1.49±0.60 | L/h | Chronic Kidney Disease; | DRUGBANK | Clearance | 1.5 | L/h | 1.54±0.95 | L/h | Chronic Kidney Disease; | DRUGBANK | Clearance | 0.0534 | L/h/kg | 0.89 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 30.8 | L | 30.8±7.5 | L | Chronic Kidney Disease; | DRUGBANK | Volume of Distribution | 34.9 | L | 34.9±9.5 | L | Chronic Kidney Disease; | DRUGBANK | Volume of Distribution | 23.8 | L | 23.8 | L | normal,healthy; | DRUGBANK | Volume of Distribution | 0.41 | L/kg | 0.41 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 5.0 | h | 4-6 | h | DRUGBANK | Half-life | 5.3 | h | 5.3 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Protein Binding | 99.8 | % | 99.8 | % | plasma proteins; | DRUGBANK |
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for children | 0.0096 | mg | 9.6 | mcg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |
| Max dose for children | 0.0096 | mg | 9.6 | mcg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |
| Max dose for adolescents | 0.0096 | mg | 9.6 | mcg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |
| Max dose for adults | 0.00024 | mg/kg | 0.24 | mcg/kg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |
| Max dose for adults | 0.0168 | mg | 16.8 | mcg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |
| Max dose for geriatric | 0.24 | mcg/kg | 0.24 | mcg/kg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |
| Max dose for geriatric | 0.0168 | mg | 16.8 | mcg | intravenous injection, IV | Zemplar Capsules | paricalcitol | PDR |