Basic Information
| Drug ID | DDPD00862 |
|
| Drug Name | Vardenafil | |
| Molecular Weight | 488.603 | |
| Molecular Formula | C23H32N6O4S | |
| CAS Number | 224785-90-4 | |
| SMILES | CCCC1=NC(C)=C2N1NC(=NC2=O)C1=C(OCC)C=CC(=C1)S(=O)(=O)N1CCN(CC)CC1 | |
| External Links | ||
| DRUGBANK | DB00862 | |
| PubChem Compound | 110634 | |
| PDR | 1251 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 1.4 | - | 1.4 | - | DRUGBANK |
| Melting Point | 192.0 | ℃ | 192 | ℃ | DRUGBANK |
| Water Solubility | 110.0 | mg/L | 0.11 | mg/ml | DRUGBANK |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| Bioavailability | 15.0 | % | ~15 | % | DRUGBANK | |
| Clearance | 56.0 | L/h | 56.0 | L/h | DRUGBANK | Clearance | 0.78 | L/h/kg | 13 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 208.0 | L | 208.0 | L | DRUGBANK | Volume of Distribution | 3.0 | L/kg | 3 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 4.5 | h | 4-5 | h | DRUGBANK | Half-life | 4.5 | h | 4.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Eliminate Route | 93.0 | % | ~91-95 | % | Faeces excretion; PO, oral; | DRUGBANK | Eliminate Route | 4.0 | % | ~2-6 | % | Urinary excretion; PO, oral; | DRUGBANK |
| Protein Binding | 95.0 | % | 95 | % | DRUGBANK |
Maximum Dosage
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Brand Name | Component | Reference |
|---|---|---|---|---|---|---|---|---|
| Max dose for adults | 20.0 | mg/day | 20 | mg/day | Tablet,PO，oral | Staxyn | vardenafil hydrochloride | PDR |
| Max dose for adults | 10.0 | mg/day | 10 | mg/day | Tablet,PO，oral | Staxyn | vardenafil hydrochloride | PDR |
| Max dose for geriatric | 20.0 | mg/day | 20 | mg/day | Tablet,PO，oral | Staxyn | vardenafil hydrochloride | PDR |
| Max dose for geriatric | 10.0 | mg/day | 10 | mg/day | Tablet,PO，oral | Staxyn | vardenafil hydrochloride | PDR |
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1