Basic Information
| Drug ID | DDPD00854 |
|
| Drug Name | Levorphanol | |
| Molecular Weight | 257.3706 | |
| Molecular Formula | C17H23NO | |
| CAS Number | 77-07-6 | |
| SMILES | [H][C@@]12CCCC[C@@]11CCN(C)[C@@H]2CC2=C1C=C(O)C=C2 | |
| External Links | ||
| DRUGBANK | DB00854 | |
| T3DB | T3D2914 | |
| PubChem Compound | 5359272 | |
| PDR | 1507 | |
| Drugs.com | Drugs.com Drug Page | |
Experimental Physicochemical Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Reference |
|---|---|---|---|---|---|
| Log P | 3.11 | - | 3.11 | - | HANSCH,C ET AL. (1995) |
| Melting Point | 198.5 | ℃ | 198-199 | ℃ | PhysProp |
| Water Solubility | 1840.0 | mg/L | 1840 | mg/L | DRUGBANK |
| pKa | 9.58 | - | 9.58 | - | SANGSTER (1994) |
Pharmacokinetic/ Toxicokinetic Property
| Property Name | Property Value | Unit | Raw Value | Raw Unit | Annotation | Reference |
|---|---|---|---|---|---|---|
| T Max | 1.0 | h | 1 | h | PO, oral; | DRUGBANK |
| Clearance | 3.9 | L/h/kg | 0.78-7.1 | L/kg/h | DRUGBANK | Clearance | 0.94 | L/h/kg | 15.7 | ml/min/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Volume of Distribution | 11.5 | L/kg | 10.0-13 | L/kg | DRUGBANK | Volume of Distribution | 11.5 | L/kg | 11.5 | L/kg | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Half-life | 13.5 | h | 11-16 | h | DRUGBANK | Half-life | 13.5 | h | 13.5 | h | intravenous injection, IV; human, homo sapiens; | Human Intravenous Pharmacokinetic Dataset |
| Toxicity LD50 | 150.0 | mg/kg | 150.0 | mg/kg | PO, oral; Rattus, Rat; | DRUGBANK | Toxicity LD50 | 150.0 | mg/kg | 150.0 | mg/kg | PO, oral; Rattus, Rat; | T3DB |
| Protein Binding | 40.0 | % | 40 | % | DRUGBANK |
Maximum Dosage
Not Available
Drug Property Radar Chart
Note: Center: Q1-1.5*IQR, Edge: Q3+1.5*IQR; Q1: Quantile 1, Q3: Quantile 3, IQR: Q3-Q1